| more general categories |
information about this item |
|
| 01. Food Nutrient & Dietary Chemicals |
 |
 |
|
01. Food Nutrient & Dietary Chemicals |
|
|
|
|
|
|
|
raffinose [ChEBI:16634] (1) |
|
 |
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
raffinose [CHEBI:16634] (1) |
|
|
|
raffinose [CHEBI:16634] (1) |
|
|
|
raffinose [CHEBI:16634] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
raffinose [CHEBI:16634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
raffinose [CHEBI:16634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
raffinose [CHEBI:16634] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:16634] |
| ChEBI Compound Description: |
A trisaccharide composed of D-galactose, D-fructose, and D-glucose. |
| ChEBI Compound Identification Number: |
16634 |
| ChEBI InChI Value: |
InChI=1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1 |
| ChEBI InChIKey Value: |
MUPFEKGTMRGPLJ-ZQSKZDJDSA-N |
| ChEBI Compound Name: |
raffinose |
| ChEBI SMILES Value: |
OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| ChEBI Substance ID: |
8144966 |
| ChEBI URL: |
ChEBI:16634 |
| ChemSpider ID: |
388379 |
| Ontomatica Chemical Accession Key (OnChAKey): |
MUPFEKGTMRGPLJ_ZQSKZDJDSA_N_000_000000 |
| PubChem Compound ID: |
439242 |