| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptomycin(3+) [CHEBI:58007] (1) |
|
|
|
streptomycin(3+) [CHEBI:58007] (1) |
|
|
|
|
|
|
|
streptomycin(3+) [CHEBI:58007] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptomycin(3+) [CHEBI:58007] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptomycin(3+) [CHEBI:58007] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptomycin(3+) [CHEBI:58007] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptomycin(3+) [CHEBI:58007] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:58007] |
| ChEBI Compound Description: |
Trication of streptomycin arising from protonation of the guanidino and secondary amino groups. |
| ChEBI Compound Identification Number: |
58007 |
| ChEBI InChI Value: |
InChI=1S/C21H39N7O12/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/h4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/p+3/t5-,6-,7+,8-,9-,10-,11+,12-,13-,14+,15+,16-,17-,18-,21+/m0/s1 |
| ChEBI InChIKey Value: |
UCSJYZPVAKXKNQ-HZYVHMACSA-Q |
| ChEBI Compound Name: |
streptomycin(3+) |
| ChEBI SMILES Value: |
C[NH2+][C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@H]1[C@@H](O[C@@H](C)[C@]1(O)C=O)O[C@H]1[C@H](O)[C@@H](O)[C@H](NC(N)=[NH2+])[C@@H](O)[C@@H]1NC(N)=[NH2+] |
| ChEBI Substance ID: |
103158321 |
| ChEBI URL: |
ChEBI:58007 |
| ChemSpider ID: |
21433944 |
| Ontomatica Chemical Accession Key (OnChAKey): |
UCSJYZPVAKXKNQ_HZYVHMACSA_Q_000_000000 |
| PubChem Compound ID: |
25245365 |