| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
deamido-NAD(2-) [CHEBI:58437] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
deamido-NAD(2-) [CHEBI:58437] (1) |
|
|
|
|
|
|
|
deamido-NAD(2-) [CHEBI:58437] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
deamido-NAD(2-) [CHEBI:58437] (1) |
|
|
|
|
|
|
|
|
|
|
|
deamido-NAD(2-) [CHEBI:58437] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
deamido-NAD(2-) [CHEBI:58437] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
deamido-NAD(2-) [CHEBI:58437] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
deamido-NAD(2-) [CHEBI:58437] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:58437] |
| ChEBI Compound Description: |
Dianion of deamido-NAD(+) arising from deprotonation of phosphate and carboxylic acid functions. |
| ChEBI Compound Identification Number: |
58437 |
| ChEBI InChI Value: |
InChI=1S/C21H26N6O15P2/c22-17-12-18(24-7-23-17)27(8-25-12)20-16(31)14(29)11(41-20)6-39-44(36,37)42-43(34,35)38-5-10-13(28)15(30)19(40-10)26-3-1-2-9(4-26)21(32)33/h1-4,7-8,10-11,13-16,19-20,28-31H,5-6H2,(H4-,22,23,24,32,33,34,35,36,37)/p-2/t10-,11-,13-,14-,15-,16-,19-,20-/m1/s1 |
| ChEBI InChIKey Value: |
SENPVEZBRZQVST-HISDBWNOSA-L |
| ChEBI Compound Name: |
deamido-NAD(2-) |
| ChEBI SMILES Value: |
Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)[n+]2cccc(c2)C([O-])=O)[C@@H](O)[C@H]1O |
| ChEBI Substance ID: |
92741356 |
| ChEBI URL: |
ChEBI:58437 |
| ChemSpider ID: |
26331176 |
| Ontomatica Chemical Accession Key (OnChAKey): |
SENPVEZBRZQVST_HISDBWNOSA_L_000_000000 |
| PubChem Compound ID: |
45266646 |