| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
citramalyl-CoA(5-) [CHEBI:57320] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
citramalyl-CoA(5-) [CHEBI:57320] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
citramalyl-CoA(5-) [CHEBI:57320] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
citramalyl-CoA(5-) [CHEBI:57320] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
citramalyl-CoA(5-) [CHEBI:57320] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
citramalyl-CoA(5-) [CHEBI:57320] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
citramalyl-CoA(5-) [CHEBI:57320] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:57320] |
| ChEBI Compound Description: |
Pentaanion of citramalyl-CoA arising from deprotonation of phosphate, diphosphate and carboxy functions. |
| ChEBI Compound Identification Number: |
57320 |
| ChEBI InChI Value: |
InChI=1S/C26H42N7O20P3S/c1-25(2,19(37)22(38)29-5-4-14(34)28-6-7-57-15(35)8-26(3,41)24(39)40)10-50-56(47,48)53-55(45,46)49-9-13-18(52-54(42,43)44)17(36)23(51-13)33-12-32-16-20(27)30-11-31-21(16)33/h11-13,17-19,23,36-37,41H,4-10H2,1-3H3,(H,28,34)(H,29,38)(H,39,40)(H,45,46)(H,47,48)(H2,27,30,31)(H2,42,43,44)/p-5/t13-,17-,18-,19+,23-,26?/m1/s1 |
| ChEBI InChIKey Value: |
XYGOWHUIVNMEIA-NOUMMWROSA-I |
| ChEBI Compound Name: |
citramalyl-CoA(5-) |
| ChEBI SMILES Value: |
CC(C)(COP([O-])(=O)OP([O-])(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP([O-])([O-])=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CC(C)(O)C([O-])=O |
| ChEBI Substance ID: |
92741174 |
| ChEBI URL: |
ChEBI:57320 |
| ChemSpider ID: |
26330696 |
| Ontomatica Chemical Accession Key (OnChAKey): |
XYGOWHUIVNMEIA_NOUMMWROSA_I_000_000000 |
| PubChem Compound ID: |
45266555 |