| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3',5'-cyclic AMP(1-) [CHEBI:58165] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3',5'-cyclic AMP(1-) [CHEBI:58165] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3',5'-cyclic AMP(1-) [CHEBI:58165] (1) |
|
|
|
|
|
|
|
|
|
|
|
3',5'-cyclic AMP(1-) [CHEBI:58165] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3',5'-cyclic AMP(1-) [CHEBI:58165] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3',5'-cyclic AMP(1-) [CHEBI:58165] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3',5'-cyclic AMP(1-) [CHEBI:58165] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:58165] |
| ChEBI Compound Description: |
"The conjugate base of 3',5'-cyclic AMP arising from deprotonation of the free phosphate OH group; major species at pH 7.3." |
| ChEBI Compound Identification Number: |
58165 |
| ChEBI InChI Value: |
InChI=1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/p-1/t4-,6-,7-,10-/m1/s1 |
| ChEBI InChIKey Value: |
IVOMOUWHDPKRLL-KQYNXXCUSA-M |
| ChEBI Compound Name: |
3',5'-cyclic AMP(1-) |
| ChEBI SMILES Value: |
Nc1ncnc2n(cnc12)[C@@H]1O[C@@H]2COP([O-])(=O)O[C@H]2[C@H]1O |
| ChEBI Substance ID: |
103158452 |
| ChEBI URL: |
ChEBI:58165 |
| ChemSpider ID: |
5415746 |
| Ontomatica Chemical Accession Key (OnChAKey): |
IVOMOUWHDPKRLL_KQYNXXCUSA_M_000_000000 |
| PubChem Compound ID: |
7059571 |