| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (1) |
|
|
|
isocitrate(3-) [CHEBI:16087] (1) |
|
|
|
isocitrate(3-) [CHEBI:16087] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (1) |
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
|
|
|
|
|
|
isocitrate(3-) [CHEBI:16087] (5) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:16087] |
| ChEBI Compound Description: |
Propan-1-ol with a hydrogen at each of the 3 carbon positions substituted with a carboxylate group. |
| ChEBI Compound Identification Number: |
16087 |
| ChEBI InChI Value: |
InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3 |
| ChEBI InChIKey Value: |
ODBLHEXUDAPZAU-UHFFFAOYSA-K |
| ChEBI Compound Name: |
isocitrate(3-) |
| ChEBI SMILES Value: |
OC(C(CC([O-])=O)C([O-])=O)C([O-])=O |
| ChEBI Substance ID: |
8145017 |
| ChEBI URL: |
ChEBI:16087 |
| ChemSpider ID: |
4573809 |
| Ontomatica Chemical Accession Key (OnChAKey): |
ODBLHEXUDAPZAU_UHFFFAOYSA_K_000_000000 |
| PubChem Compound ID: |
5460172 |