| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
|
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
|
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
|
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dCMP(2-) [CHEBI:57566] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:57566] |
| ChEBI Compound Description: |
Dianion of 2'-deoxycytosine 5'-monophosphate arising from deprotonation of both OH groups of the phosphate. |
| ChEBI Compound Identification Number: |
57566 |
| ChEBI InChI Value: |
InChI=1S/C9H14N3O7P/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(19-8)4-18-20(15,16)17/h1-2,5-6,8,13H,3-4H2,(H2,10,11,14)(H2,15,16,17)/p-2/t5-,6+,8+/m0/s1 |
| ChEBI InChIKey Value: |
NCMVOABPESMRCP-SHYZEUOFSA-L |
| ChEBI Compound Name: |
dCMP(2-) |
| ChEBI SMILES Value: |
Nc1ccn([C@H]2C[C@H](O)[C@@H](COP([O-])([O-])=O)O2)c(=O)n1 |
| ChEBI Substance ID: |
99319246 |
| ChEBI URL: |
ChEBI:57566 |
| ChemSpider ID: |
5414501 |
| Ontomatica Chemical Accession Key (OnChAKey): |
NCMVOABPESMRCP_SHYZEUOFSA_L_000_000000 |
| PubChem Compound ID: |
7058169 |