| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
 |
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pantetheine [CHEBI:16753] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:16753] |
| ChEBI Compound Description: |
An amide obtained by formal condensation of the carboxy group of pantothenic acid and the maino group of cysteamine. |
| ChEBI Compound Identification Number: |
16753 |
| ChEBI InChI Value: |
InChI=1S/C11H22N2O4S/c1-11(2,7-14)9(16)10(17)13-4-3-8(15)12-5-6-18/h9,14,16,18H,3-7H2,1-2H3,(H,12,15)(H,13,17)/t9-/m0/s1 |
| ChEBI InChIKey Value: |
ZNXZGRMVNNHPCA-VIFPVBQESA-N |
| ChEBI Compound Name: |
pantetheine |
| ChEBI SMILES Value: |
CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCS |
| ChEBI Substance ID: |
8144916 |
| ChEBI URL: |
ChEBI:16753 |
| ChemSpider ID: |
388453 |
| Ontomatica Chemical Accession Key (OnChAKey): |
ZNXZGRMVNNHPCA_VIFPVBQESA_N_000_000000 |
| PubChem Compound ID: |
439322 |