| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20-hydroxy-3-oxopregn-4-en-21-al [CHEBI:15690] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:15690] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
15690 |
| ChEBI InChI Value: |
InChI=1S/C21H30O3/c1-20-9-7-14(23)11-13(20)3-4-15-16-5-6-18(19(24)12-22)21(16,2)10-8-17(15)20/h11-12,15-19,24H,3-10H2,1-2H3/t15-,16-,17-,18+,19?,20-,21-/m0/s1 |
| ChEBI InChIKey Value: |
HIXLXYQKUSOMDM-FYGMKCHKSA-N |
| ChEBI Compound Name: |
20-hydroxy-3-oxopregn-4-en-21-al |
| ChEBI SMILES Value: |
[H]C(=O)C(O)[C@H]1CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| ChEBI Substance ID: |
8143379 |
| ChEBI URL: |
ChEBI:15690 |
| ChemSpider ID: |
389209 |
| Ontomatica Chemical Accession Key (OnChAKey): |
HIXLXYQKUSOMDM_FYGMKCHKSA_N_000_000000 |
| PubChem Compound ID: |
440224 |