| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate [CHEBI:57641] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:57641] |
| ChEBI Compound Description: |
"The conjugate base of 2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetic acid; major species at pH 7.3." |
| ChEBI Compound Identification Number: |
57641 |
| ChEBI InChI Value: |
InChI=1S/C6H4Cl2O4/c7-3-1-6(8,2-4(9)10)12-5(3)11/h1H,2H2,(H,9,10)/p-1 |
| ChEBI InChIKey Value: |
RNYNGUYSDYOCLB-UHFFFAOYSA-M |
| ChEBI Compound Name: |
2,4-dichloro-5-oxo-2,5-dihydro-2-furylacetate |
| ChEBI SMILES Value: |
[O-]C(=O)CC1(Cl)OC(=O)C(Cl)=C1 |
| ChEBI Substance ID: |
99319307 |
| ChEBI URL: |
ChEBI:57641 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
RNYNGUYSDYOCLB_UHFFFAOYSA_M_000_000000 |
| PubChem Compound ID: |
21145098 |