| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5'-xanthylate(2-) [CHEBI:57464] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5'-xanthylate(2-) [CHEBI:57464] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5'-xanthylate(2-) [CHEBI:57464] (1) |
|
|
|
|
|
|
|
5'-xanthylate(2-) [CHEBI:57464] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5'-xanthylate(2-) [CHEBI:57464] (1) |
|
|
|
|
|
|
|
|
|
|
|
5'-xanthylate(2-) [CHEBI:57464] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5'-xanthylate(2-) [CHEBI:57464] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5'-xanthylate(2-) [CHEBI:57464] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5'-xanthylate(2-) [CHEBI:57464] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:57464] |
| ChEBI Compound Description: |
Dianion of 5'-xanthylic acid arising from deprotonation of both phosphate OH groups. |
| ChEBI Compound Identification Number: |
57464 |
| ChEBI InChI Value: |
InChI=1S/C10H13N4O9P/c15-5-3(1-22-24(19,20)21)23-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H2,19,20,21)(H2,12,13,17,18)/p-2/t3-,5-,6-,9-/m1/s1 |
| ChEBI InChIKey Value: |
DCTLYFZHFGENCW-UUOKFMHZSA-L |
| ChEBI Compound Name: |
5'-xanthylate(2-) |
| ChEBI SMILES Value: |
O[C@@H]1[C@@H](COP([O-])([O-])=O)O[C@H]([C@@H]1O)n1cnc2c1[nH]c(=O)[nH]c2=O |
| ChEBI Substance ID: |
99319155 |
| ChEBI URL: |
ChEBI:57464 |
| ChemSpider ID: |
10463791 |
| Ontomatica Chemical Accession Key (OnChAKey): |
DCTLYFZHFGENCW_UUOKFMHZSA_L_000_000000 |
| PubChem Compound ID: |
23421208 |