| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cis-cyclohexa-3,5-diene-1,2-diol [CHEBI:16190] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:16190] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
16190 |
| ChEBI InChI Value: |
InChI=1S/C6H8O2/c7-5-3-1-2-4-6(5)8/h1-8H/t5-,6+ |
| ChEBI InChIKey Value: |
YDRSQRPHLBEPTP-OLQVQODUSA-N |
| ChEBI Compound Name: |
cis-cyclohexa-3,5-diene-1,2-diol |
| ChEBI SMILES Value: |
O[C@H]1C=CC=C[C@H]1O |
| ChEBI Substance ID: |
8145687 |
| ChEBI URL: |
ChEBI:16190 |
| ChemSpider ID: |
154113 |
| Ontomatica Chemical Accession Key (OnChAKey): |
YDRSQRPHLBEPTP_OLQVQODUSA_N_000_000000 |
| PubChem Compound ID: |
176951 |