| more general categories |
information about this item |
|
| 01. Food Nutrient & Dietary Chemicals |
 |
 |
|
01. Food Nutrient & Dietary Chemicals |
|
|
|
|
|
|
|
zeaxanthin [ChEBI:27547] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
zeaxanthin [ChEBI:27547] (1) |
|
 |
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
 |
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
|
|
|
|
|
|
|
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
|
|
|
|
|
|
|
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
|
|
|
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
 |
| 06. Name of Biological Source of Chemical |
 |
 |
|
06. Name of Biological Source of Chemical |
|
|
|
|
|
|
|
|
|
|
|
Oscillatoria (29) |
|
 |
| 07. Part of Biological Source of Chemical |
 |
 |
|
07. Part of Biological Source of Chemical |
|
|
|
unspecified structure [PO:0000004] (703) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
 |
| 09. Chemical Capabilities |
 |
 |
|
09. Chemical Capabilities |
|
|
|
zeaxanthin [CHEBI:27547] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:27547] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
27547 |
| ChEBI InChI Value: |
InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-24,35-36,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36-/m1/s1 |
| ChEBI InChIKey Value: |
JKQXZKUSFCKOGQ-QAYBQHTQSA-N |
| ChEBI Compound Name: |
zeaxanthin |
| ChEBI SMILES Value: |
CC(\C=C\C=C(C)\C=C\C1=C(C)C[C@@H](O)CC1(C)C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C |
| ChEBI Substance ID: |
11533172 |
| ChEBI URL: |
ChEBI:27547 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
JKQXZKUSFCKOGQ_QAYBQHTQSA_N_000_000000 |
| PubChem Compound ID: |
5280899 |