New Search

Item 1 of 1 (back to results)

naphthalene-1,2-diol
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Oxidoreductases [EC:1] (1697) 
 Acting on the CH-CH group of donors [EC:1.3] (238) 
 With NAD or NADP as acceptor [EC:1.3.1] (140) 
 Cis-1,2-dihydro-1,2-dihydroxynaphthalene dehydrogenase [EC:1.3.1.29] (4) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 Acting on single donors with incorporation of molecular oxygen (oxygenases) [EC:1.13] (176) 
 With incorporation of two atoms of oxygen [EC:1.13.11] (139) 
 1,2-dihydroxynaphthalene dioxygenase [EC:1.13.11.56] (4) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 Acting on paired donors, with incorporation or reduction of molecular oxygen [EC:1.14] (587) 
 With NADH or NADPH as one donor, and incorporation of one atom of oxygen [EC:1.14.13] (391) 
 1-hydroxy-2-naphthoate hydroxylase [EC:1.14.13.135] (10) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 hydroxynaphthalene [CHEBI:24727] (23) 
 naphthalenediols [CHEBI:23783] (12) 
 naphthalenediol [CHEBI:38133] (3) 
 naphthalene-1,2-diol [CHEBI:17435] (1)
ChEBI Compound Accession Identifier  [CHEBI:17435]
ChEBI Compound Description  null
ChEBI Compound Identification Number  17435
ChEBI InChI Value  InChI=1S/C10H8O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,11-12H
ChEBI InChIKey Value  NXPPAOGUKPJVDI-UHFFFAOYSA-N
ChEBI Compound Name  naphthalene-1,2-diol
ChEBI SMILES Value  Oc1ccc2ccccc2c1O
ChEBI Substance ID  8144140
ChEBI URL  ChEBI:17435
ChemSpider ID  10842
Ontomatica Chemical Accession Key (OnChAKey)  NXPPAOGUKPJVDI_UHFFFAOYSA_N_000_000000
PubChem Compound ID  11318