New Search

Item 1 of 1 (back to results)

HBOA
A benzoxazine bearing hydroxy and oxo substituents at positions 2 and 3 respectively.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 allelochemical [CHEBI:62215] (3) 
 HBOA [CHEBI:63559] (1)
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Oxidoreductases [EC:1] (1697) 
 Acting on paired donors, with incorporation or reduction of molecular oxygen [EC:1.14] (587) 
 With NADH or NADPH as one donor, and incorporation of one atom of oxygen [EC:1.14.13] (391) 
 3-hydroxyindolin-2-one monooxygenase [EC:1.14.13.139] (9) 
 HBOA [CHEBI:63559] (1)
 2-hydroxy-1,4-benzoxazin-3-one monooxygenase [EC:1.14.13.140] (9) 
 HBOA [CHEBI:63559] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hemiacetal [CHEBI:5653] (52) 
 lactol [CHEBI:38131] (51) 
 HBOA [CHEBI:63559] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 cyclic amide [CHEBI:3990] (252) 
 lactam [CHEBI:24995] (252) 
 HBOA [CHEBI:63559] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 HBOA [CHEBI:63559] (1)
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hemiacetal [CHEBI:5653] (52) 
 lactol [CHEBI:38131] (51) 
 HBOA [CHEBI:63559] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 HBOA [CHEBI:63559] (1)
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 HBOA [CHEBI:63559] (1)
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hemiacetal [CHEBI:5653] (52) 
 lactol [CHEBI:38131] (51) 
 HBOA [CHEBI:63559] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 HBOA [CHEBI:63559] (1)
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 HBOA [CHEBI:63559] (1)
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 HBOA [CHEBI:63559] (1)
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 HBOA [CHEBI:63559] (1)
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxazine [CHEBI:46969] (6) 
 HBOA [CHEBI:63559] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hemiacetal [CHEBI:5653] (52) 
 lactol [CHEBI:38131] (51) 
 HBOA [CHEBI:63559] (1)
ChEBI Compound Accession Identifier  [CHEBI:63559]
ChEBI Compound Description  A benzoxazine bearing hydroxy and oxo substituents at positions 2 and 3 respectively.
ChEBI Compound Identification Number  63559
ChEBI InChI Value  InChI=1S/C8H7NO3/c10-7-8(11)12-6-4-2-1-3-5(6)9-7/h1-4,8,11H,(H,9,10)
ChEBI InChIKey Value  VMQBFYRBJKDACN-UHFFFAOYSA-N
ChEBI Compound Name  HBOA
ChEBI SMILES Value  OC1Oc2ccccc2NC1=O
ChEBI Substance ID  135610952
ChEBI URL  ChEBI:63559
ChemSpider ID  285673
Ontomatica Chemical Accession Key (OnChAKey)  VMQBFYRBJKDACN_UHFFFAOYSA_N_000_000000
PubChem Compound ID  322636