New Search

Item 2 of 5 (back to results)
Previous previous next Next

(R)-pantothenate
A pantothenate that is the conjugate base of (R)-pantothenic acid, obtained by deprotonation of the carboxy group.


Current search:

04. Bioactive Capabilities of Specific Chemicals : Transferases [EC:2] > Transferring phosphorus-containing groups [EC:2.7]
×

Select any link to see items in a related category.

more general categories    information about this item
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Transferases [EC:2] (1441) 
 Transferring phosphorus-containing groups [EC:2.7] (369) 
 Phosphotransferases with an alcohol group as acceptor [EC:2.7.1] (217) 
 Pantothenate kinase [EC:2.7.1.33] (5) 
 (R)-pantothenate [CHEBI:29032] (1)
 Hydrolases [EC:3] (824) 
 Acting on carbon-nitrogen bonds, other than peptide bonds [EC:3.5] (303) 
 In linear amides [EC:3.5.1] (174) 
 Pantothenase [EC:3.5.1.22] (4) 
 (R)-pantothenate [CHEBI:29032] (1)
 Pantetheine hydrolase [EC:3.5.1.92] (4) 
 (R)-pantothenate [CHEBI:29032] (1)
 Ligases [EC:6] (206) 
 Forming carbon—nitrogen bonds [EC:6.3] (134) 
 Acid—Amino-Acid Ligases (Peptide Synthases) [EC:6.3.2] (70) 
 Pantoate--beta-alanine ligase [EC:6.3.2.1] (7) 
 (R)-pantothenate [CHEBI:29032] (1)
 Pantoate--beta-alanine ligase (ADP-forming) [EC:6.3.2.n5] (6) 
 (R)-pantothenate [CHEBI:29032] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantothenates [CHEBI:25847] (2) 
 pantothenate [CHEBI:16454] (2) 
 (R)-pantothenate [CHEBI:29032] (1)
ChEBI Compound Accession Identifier  [CHEBI:29032]
ChEBI Compound Description  A pantothenate that is the conjugate base of (R)-pantothenic acid, obtained by deprotonation of the carboxy group.
ChEBI Compound Identification Number  29032
ChEBI InChI Value  InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/p-1/t7-/m0/s1
ChEBI InChIKey Value  GHOKWGTUZJEAQD-ZETCQYMHSA-M
ChEBI Compound Name  (R)-pantothenate
ChEBI SMILES Value  CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O
ChEBI Substance ID  8145487
ChEBI URL  ChEBI:29032
ChemSpider ID  146912
Ontomatica Chemical Accession Key (OnChAKey)  GHOKWGTUZJEAQD_ZETCQYMHSA_M_000_000000
PubChem Compound ID  167945