| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
streptothricin F(3+) [CHEBI:60822] (1) |
|
 |
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin F(3+) [CHEBI:60822] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin F(3+) [CHEBI:60822] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin F(3+) [CHEBI:60822] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin F(3+) [CHEBI:60822] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin F(3+) [CHEBI:60822] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin F(3+) [CHEBI:60822] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin F(3+) [CHEBI:60822] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin F(3+) [CHEBI:60822] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:60822] |
| ChEBI Compound Description: |
A primary aliphatic ammonium ion which is obtained from streptothricin F by protonation of the guanidino and amino groups. |
| ChEBI Compound Identification Number: |
60822 |
| ChEBI InChI Value: |
InChI=1S/C19H34N8O8/c20-3-1-2-7(21)4-10(30)24-13-14(31)15(35-18(22)33)9(6-28)34-17(13)27-19-25-11-8(29)5-23-16(32)12(11)26-19/h7-9,11-15,17,28-29,31H,1-6,20-21H2,(H2,22,33)(H,23,32)(H,24,30)(H2,25,26,27)/p+3/t7-,8+,9+,11+,12-,13+,14-,15-,17+/m0/s1 |
| ChEBI InChIKey Value: |
NRAUADCLPJTGSF-VLSXYIQESA-Q |
| ChEBI Compound Name: |
streptothricin F(3+) |
| ChEBI SMILES Value: |
[H][C@]12N\\C(N[C@]1([H])C(=O)NC[C@H]2O)=[NH+]/[C@@H]1O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]1NC(=O)C[C@@H]([NH3+])CCC[NH3+] |
| ChEBI Substance ID: |
104222418 |
| ChEBI URL: |
ChEBI:60822 |
| ChemSpider ID: |
26332014 |
| Ontomatica Chemical Accession Key (OnChAKey): |
NRAUADCLPJTGSF_VLSXYIQESA_Q_000_000000 |
| PubChem Compound ID: |
49852374 |