| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
D-tagatofuranose 1,6-bisphosphate(4-) [CHEBI:58694] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
D-tagatofuranose 1,6-bisphosphate(4-) [CHEBI:58694] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
D-tagatofuranose 1,6-bisphosphate(4-) [CHEBI:58694] (1) |
|
|
|
|
|
|
|
|
|
|
|
D-tagatofuranose 1,6-bisphosphate(4-) [CHEBI:58694] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
D-tagatofuranose 1,6-bisphosphate(4-) [CHEBI:58694] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
D-tagatofuranose 1,6-bisphosphate(4-) [CHEBI:58694] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
D-tagatofuranose 1,6-bisphosphate(4-) [CHEBI:58694] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:58694] |
| ChEBI Compound Description: |
Tetraanion of D-tagatofuranose 1,6-bisphosphate. |
| ChEBI Compound Identification Number: |
58694 |
| ChEBI InChI Value: |
InChI=1S/C6H14O12P2/c7-4-3(1-16-19(10,11)12)18-6(9,5(4)8)2-17-20(13,14)15/h3-5,7-9H,1-2H2,(H2,10,11,12)(H2,13,14,15)/p-4/t3-,4+,5+,6?/m1/s1 |
| ChEBI InChIKey Value: |
RNBGYGVWRKECFJ-OEXCPVAWSA-J |
| ChEBI Compound Name: |
D-tagatofuranose 1,6-bisphosphate(4-) |
| ChEBI SMILES Value: |
O[C@@H]1[C@H](O)C(O)(COP([O-])([O-])=O)O[C@@H]1COP([O-])([O-])=O |
| ChEBI Substance ID: |
92741577 |
| ChEBI URL: |
ChEBI:58694 |
| ChemSpider ID: |
26331307 |
| Ontomatica Chemical Accession Key (OnChAKey): |
RNBGYGVWRKECFJ_OEXCPVAWSA_J_000_000000 |
| PubChem Compound ID: |
15043189 |