New Search

Item 2 of 2 (back to results)
Previous previous

mycocyclosin
An organic heterotetracyclic compound obtained via intramolecular oxidative aromatic coupling of cyclo(L-tyrosyl-L-tyrosyl).


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 mycocyclosin [CHEBI:71596] (1)
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Oxidoreductases [EC:1] (1697) 
 Acting on paired donors, with incorporation or reduction of molecular oxygen [EC:1.14] (587) 
 With NADH or NADPH as one donor, and the other dehydrogenated [EC:1.14.21] (28) 
 Mycocyclosin synthase [EC:1.14.21.9] (7) 
 mycocyclosin [CHEBI:71596] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 mycocyclosin [CHEBI:71596] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 cyclic peptide [CHEBI:23449] (75) 
 homodetic cyclic peptide [CHEBI:24613] (46) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 cyclic peptide [CHEBI:23449] (75) 
 homodetic cyclic peptide [CHEBI:24613] (46) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 cyclic peptide [CHEBI:23449] (75) 
 homodetic cyclic peptide [CHEBI:24613] (46) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 mycocyclosin [CHEBI:71596] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 cyclic peptide [CHEBI:23449] (75) 
 homodetic cyclic peptide [CHEBI:24613] (46) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 cyclic peptide [CHEBI:23449] (75) 
 homodetic cyclic peptide [CHEBI:24613] (46) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 mycocyclosin [CHEBI:71596] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 cyclic peptide [CHEBI:23449] (75) 
 homodetic cyclic peptide [CHEBI:24613] (46) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 cyclic peptide [CHEBI:23449] (75) 
 homodetic cyclic peptide [CHEBI:24613] (46) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 cyclic peptide [CHEBI:23449] (75) 
 homodetic cyclic peptide [CHEBI:24613] (46) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 mycocyclosin [CHEBI:71596] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 cyclic peptide [CHEBI:23449] (75) 
 homodetic cyclic peptide [CHEBI:24613] (46) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 mycocyclosin [CHEBI:71596] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 mycocyclosin [CHEBI:71596] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 mycocyclosin [CHEBI:71596] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 mycocyclosin [CHEBI:71596] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 mycocyclosin [CHEBI:71596] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 mycocyclosin [CHEBI:71596] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 mycocyclosin [CHEBI:71596] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 mycocyclosin [CHEBI:71596] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinone [CHEBI:46846] (14) 
 2,5-diketopiperazines [CHEBI:65061] (13) 
 mycocyclosin [CHEBI:71596] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 mycocyclosin [CHEBI:71596] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 mycocyclosin [CHEBI:71596] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 mycocyclosin [CHEBI:71596] (1)
ChEBI Compound Accession Identifier  [CHEBI:71596]
ChEBI Compound Description  An organic heterotetracyclic compound obtained via intramolecular oxidative aromatic coupling of cyclo(L-tyrosyl-L-tyrosyl).
ChEBI Compound Identification Number  71596
ChEBI InChI Value  InChI=1S/C18H16N2O4/c21-15-3-1-9-5-11(15)12-6-10(2-4-16(12)22)8-14-18(24)19-13(7-9)17(23)20-14/h1-6,13-14,21-22H,7-8H2,(H,19,24)(H,20,23)/t13-,14-/m0/s1
ChEBI InChIKey Value  PYDUENRHWXNYLP-KBPBESRZSA-N
ChEBI Compound Name  mycocyclosin
ChEBI SMILES Value  Oc1ccc2C[C@@H]3NC(=O)[C@H](Cc4ccc(O)c(c4)-c1c2)NC3=O
ChEBI Substance ID  160713483
ChEBI URL  ChEBI:71596
ChemSpider ID  27444986
Ontomatica Chemical Accession Key (OnChAKey)  PYDUENRHWXNYLP_KBPBESRZSA_N_000_000000
PubChem Compound ID  59053147