Item 2 of 11 (back to results) previous next pantetheine An amide obtained by formal condensation of the carboxy group of pantothenic acid and the maino group of cysteamine.

Current search: 04. Bioactive Capabilities of Specific Chemicals : Transferases [EC:2] × 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > pnictogen molecular entity [CHEBI:33302] > nitrogen molecular entity [CHEBI:51143] > amide [CHEBI:32988] > primary amide [CHEBI:33256] > carboxamide [CHEBI:37622] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   pantetheine [CHEBI:16753] (1) 04. Bioactive Capabilities of Specific Chemicals   04. Bioactive Capabilities of Specific Chemicals  Transferases [EC:2] (1441)   Transferring phosphorus-containing groups [EC:2.7] (369)   Phosphotransferases with an alcohol group as acceptor [EC:2.7.1] (217)   Pantetheine kinase [EC:2.7.1.34] (5)   pantetheine [CHEBI:16753] (1)  Hydrolases [EC:3] (824)   Acting on carbon-nitrogen bonds, other than peptide bonds [EC:3.5] (303)   In linear amides [EC:3.5.1] (174)   Pantetheine hydrolase [EC:3.5.1.92] (4)   pantetheine [CHEBI:16753] (1)  Lyases [EC:4] (743)   Carbon-carbon lyases [EC:4.1] (299)   Carboxy-Lyases [EC:4.1.1] (172)   Pantothenoylcysteine decarboxylase [EC:4.1.1.30] (4)   pantetheine [CHEBI:16753] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  carboxamide [CHEBI:37622] (1381)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   beta-alanine derivative [CHEBI:22823] (18)   pantothenic acids [CHEBI:25848] (7)   pantetheines [CHEBI:25845] (4)   pantetheine [CHEBI:16753] (1) ChEBI Compound Accession Identifier:   [CHEBI:16753] ChEBI Compound Description:   An amide obtained by formal condensation of the carboxy group of pantothenic acid and the maino group of cysteamine. ChEBI Compound Identification Number:   16753 ChEBI InChI Value:   InChI=1S/C11H22N2O4S/c1-11(2,7-14)9(16)10(17)13-4-3-8(15)12-5-6-18/h9,14,16,18H,3-7H2,1-2H3,(H,12,15)(H,13,17)/t9-/m0/s1 ChEBI InChIKey Value:   ZNXZGRMVNNHPCA-VIFPVBQESA-N ChEBI Compound Name:   pantetheine ChEBI SMILES Value:   CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCS ChEBI Substance ID:   8144916 ChEBI URL:   ChEBI:16753 ChemSpider ID:   388453 Ontomatica Chemical Accession Key (OnChAKey):   ZNXZGRMVNNHPCA_VIFPVBQESA_N_000_000000 PubChem Compound ID:   439322