Item 11 of 17 (back to results) previous next 5-hydroxyisouric acid 5,7-Dihydro-1H-purine-2,6,8(9H)-trione in which the hydrogen at position 5 is substituted by a hydroxy group.

Current search: 04. Bioactive Capabilities of Specific Chemicals : Oxidoreductases [EC:1] × 08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367] > cyclic compound [CHEBI:33595] > heterocyclic compound [CHEBI:5686] > heteropolycyclic compound [CHEBI:33671] > organic heteropolycyclic compound [CHEBI:38166] > organic heterobicyclic compound [CHEBI:27171] > imidazopyrimidine [CHEBI:35875] > purines [CHEBI:26401] × Select any link to see items in a related category. more general categories    information about this item 04. Bioactive Capabilities of Specific Chemicals   04. Bioactive Capabilities of Specific Chemicals  Oxidoreductases [EC:1] (1697)   Acting on other nitrogenous compounds as donors [EC:1.7] (34)   With oxygen as acceptor [EC:1.7.3] (9)   Factor independent urate hydroxylase [EC:1.7.3.3] (5)   5-hydroxyisouric acid [CHEBI:18072] (1)  Acting on paired donors, with incorporation or reduction of molecular oxygen [EC:1.14] (587)   With NADH or NADPH as one donor, and incorporation of one atom of oxygen [EC:1.14.13] (391)   FAD-dependent urate hydroxylase [EC:1.14.13.113] (6)   5-hydroxyisouric acid [CHEBI:18072] (1)  Hydrolases [EC:3] (824)   Acting on carbon-nitrogen bonds, other than peptide bonds [EC:3.5] (303)   In cyclic amides [EC:3.5.2] (40)   Hydroxyisourate hydrolase [EC:3.5.2.17] (4)   5-hydroxyisouric acid [CHEBI:18072] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   imidazopyrimidine [CHEBI:35875] (321)   purines [CHEBI:26401] (320)   oxopurine [CHEBI:25810] (43)   uric acid [CHEBI:27226] (12)   5-hydroxyisouric acid [CHEBI:18072] (1) ChEBI Compound Accession Identifier:   [CHEBI:18072] ChEBI Compound Description:   5,7-Dihydro-1H-purine-2,6,8(9H)-trione in which the hydrogen at position 5 is substituted by a hydroxy group. ChEBI Compound Identification Number:   18072 ChEBI InChI Value:   InChI=1S/C5H4N4O4/c10-2-5(13)1(6-3(11)8-2)7-4(12)9-5/h13H,(H3,6,7,8,9,10,11,12) ChEBI InChIKey Value:   LTQYPAVLAYVKTK-UHFFFAOYSA-N ChEBI Compound Name:   5-hydroxyisouric acid ChEBI SMILES Value:   OC12NC(=O)NC1=NC(=O)NC2=O ChEBI Substance ID:   49693431 ChEBI URL:   ChEBI:18072 ChemSpider ID:   219288 Ontomatica Chemical Accession Key (OnChAKey):   LTQYPAVLAYVKTK_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   250388