New Search

Item 11 of 11 (back to results)
Previous previous

tryprostatin B
A cyclic dipeptide that is brevianamide F (cyclo-L-Trp-L-Pro) substituted at position 2 on the indole ring by a prenyl group.


Current search:

04. Bioactive Capabilities of Specific Chemicals : Transferases [EC:2]
×

Select any link to see items in a related category.

more general categories    information about this item
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Oxidoreductases [EC:1] (1697) 
 Acting on paired donors, with incorporation or reduction of molecular oxygen [EC:1.14] (587) 
 With NADH or NADPH as one donor, and incorporation of one atom of oxygen [EC:1.14.13] (391) 
 Tryprostatin B 6-hydroxylase [EC:1.14.13.176] (7) 
 tryprostatin B [CHEBI:72760] (1)
 Transferases [EC:2] (1441) 
 Transferring alkyl or aryl groups, other than methyl groups [EC:2.5] (171) 
 Transferring Alkyl or Aryl Groups, Other than Methyl Groups [EC:2.5.1] (171) 
 Tryprostatin B synthase [EC:2.5.1.106] (4) 
 tryprostatin B [CHEBI:72760] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 tryprostatin B [CHEBI:72760] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 alkaloid [CHEBI:22315] (473) 
 indole alkaloid [CHEBI:38958] (144) 
 tryprostatin B [CHEBI:72760] (1)
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 tryprostatin B [CHEBI:72760] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 tryprostatin B [CHEBI:72760] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 tryprostatin B [CHEBI:72760] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 tryprostatin B [CHEBI:72760] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 alkaloid [CHEBI:22315] (473) 
 indole alkaloid [CHEBI:38958] (144) 
 tryprostatin B [CHEBI:72760] (1)
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 tryprostatin B [CHEBI:72760] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 tryprostatin B [CHEBI:72760] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 tryprostatin B [CHEBI:72760] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 oligopeptide [CHEBI:7755] (479) 
 dipeptide [CHEBI:46761] (253) 
 tryprostatin B [CHEBI:72760] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
 pyrrolopyrazine [CHEBI:48337] (9) 
 tryprostatin B [CHEBI:72760] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 tryprostatin B [CHEBI:72760] (1)
ChEBI Compound Accession Identifier  [CHEBI:72760]
ChEBI Compound Description  A cyclic dipeptide that is brevianamide F (cyclo-L-Trp-L-Pro) substituted at position 2 on the indole ring by a prenyl group.
ChEBI Compound Identification Number  72760
ChEBI InChI Value  InChI=1S/C21H25N3O2/c1-13(2)9-10-17-15(14-6-3-4-7-16(14)22-17)12-18-21(26)24-11-5-8-19(24)20(25)23-18/h3-4,6-7,9,18-19,22H,5,8,10-12H2,1-2H3,(H,23,25)/t18-,19-/m0/s1
ChEBI InChIKey Value  GLWYBXPXOSKQAW-OALUTQOASA-N
ChEBI Compound Name  tryprostatin B
ChEBI SMILES Value  [H][C@@]12CCCN1C(=O)[C@H](Cc1c(CC=C(C)C)[nH]c3ccccc13)NC2=O
ChEBI Substance ID  162012140
ChEBI URL  ChEBI:72760
ChemSpider ID  8038977
Ontomatica Chemical Accession Key (OnChAKey)  GLWYBXPXOSKQAW_OALUTQOASA_N_000_000000
PubChem Compound ID  9863281