Item 11 of 11 (back to results) previous tryprostatin B A cyclic dipeptide that is brevianamide F (cyclo-L-Trp-L-Pro) substituted at position 2 on the indole ring by a prenyl group.

Current search: 04. Bioactive Capabilities of Specific Chemicals : Transferases [EC:2] × 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > pnictogen molecular entity [CHEBI:33302] > nitrogen molecular entity [CHEBI:51143] > amide [CHEBI:32988] > primary amide [CHEBI:33256] > carboxamide [CHEBI:37622] × Select any link to see items in a related category. more general categories    information about this item 04. Bioactive Capabilities of Specific Chemicals   04. Bioactive Capabilities of Specific Chemicals  Oxidoreductases [EC:1] (1697)   Acting on paired donors, with incorporation or reduction of molecular oxygen [EC:1.14] (587)   With NADH or NADPH as one donor, and incorporation of one atom of oxygen [EC:1.14.13] (391)   Tryprostatin B 6-hydroxylase [EC:1.14.13.176] (7)   tryprostatin B [CHEBI:72760] (1)  Transferases [EC:2] (1441)   Transferring alkyl or aryl groups, other than methyl groups [EC:2.5] (171)   Transferring Alkyl or Aryl Groups, Other than Methyl Groups [EC:2.5.1] (171)   Tryprostatin B synthase [EC:2.5.1.106] (4)   tryprostatin B [CHEBI:72760] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   tryprostatin B [CHEBI:72760] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   indole alkaloid [CHEBI:38958] (144)   tryprostatin B [CHEBI:72760] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   tryprostatin B [CHEBI:72760] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   tryprostatin B [CHEBI:72760] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   tryprostatin B [CHEBI:72760] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   tryprostatin B [CHEBI:72760] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   indole alkaloid [CHEBI:38958] (144)   tryprostatin B [CHEBI:72760] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   tryprostatin B [CHEBI:72760] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   tryprostatin B [CHEBI:72760] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   tryprostatin B [CHEBI:72760] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   oligopeptide [CHEBI:7755] (479)   dipeptide [CHEBI:46761] (253)   tryprostatin B [CHEBI:72760] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1)  pyrrolopyrazine [CHEBI:48337] (9)   tryprostatin B [CHEBI:72760] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryprostatin B [CHEBI:72760] (1) ChEBI Compound Accession Identifier:   [CHEBI:72760] ChEBI Compound Description:   A cyclic dipeptide that is brevianamide F (cyclo-L-Trp-L-Pro) substituted at position 2 on the indole ring by a prenyl group. ChEBI Compound Identification Number:   72760 ChEBI InChI Value:   InChI=1S/C21H25N3O2/c1-13(2)9-10-17-15(14-6-3-4-7-16(14)22-17)12-18-21(26)24-11-5-8-19(24)20(25)23-18/h3-4,6-7,9,18-19,22H,5,8,10-12H2,1-2H3,(H,23,25)/t18-,19-/m0/s1 ChEBI InChIKey Value:   GLWYBXPXOSKQAW-OALUTQOASA-N ChEBI Compound Name:   tryprostatin B ChEBI SMILES Value:   [H][C@@]12CCCN1C(=O)[C@H](Cc1c(CC=C(C)C)[nH]c3ccccc13)NC2=O ChEBI Substance ID:   162012140 ChEBI URL:   ChEBI:72760 ChemSpider ID:   8038977 Ontomatica Chemical Accession Key (OnChAKey):   GLWYBXPXOSKQAW_OALUTQOASA_N_000_000000 PubChem Compound ID:   9863281