New Search

Item 12 of 26 (back to results)
Previous previous next Next

pantetheine
An amide obtained by formal condensation of the carboxy group of pantothenic acid and the maino group of cysteamine.


Current search:

04. Bioactive Capabilities of Specific Chemicals : Hydrolases [EC:3] > Acting on carbon-nitrogen bonds, other than peptide bonds [EC:3.5]
×
03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 pantetheine [CHEBI:16753] (1)
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Transferases [EC:2] (1441) 
 Transferring phosphorus-containing groups [EC:2.7] (369) 
 Phosphotransferases with an alcohol group as acceptor [EC:2.7.1] (217) 
 Pantetheine kinase [EC:2.7.1.34] (5) 
 pantetheine [CHEBI:16753] (1)
 Hydrolases [EC:3] (824) 
 Acting on carbon-nitrogen bonds, other than peptide bonds [EC:3.5] (303) 
 In linear amides [EC:3.5.1] (174) 
 Pantetheine hydrolase [EC:3.5.1.92] (4) 
 pantetheine [CHEBI:16753] (1)
 Lyases [EC:4] (743) 
 Carbon-carbon lyases [EC:4.1] (299) 
 Carboxy-Lyases [EC:4.1.1] (172) 
 Pantothenoylcysteine decarboxylase [EC:4.1.1.30] (4) 
 pantetheine [CHEBI:16753] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 carboxamide [CHEBI:37622] (1381) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 beta-alanine derivative [CHEBI:22823] (18) 
 pantothenic acids [CHEBI:25848] (7) 
 pantetheines [CHEBI:25845] (4) 
 pantetheine [CHEBI:16753] (1)
ChEBI Compound Accession Identifier  [CHEBI:16753]
ChEBI Compound Description  An amide obtained by formal condensation of the carboxy group of pantothenic acid and the maino group of cysteamine.
ChEBI Compound Identification Number  16753
ChEBI InChI Value  InChI=1S/C11H22N2O4S/c1-11(2,7-14)9(16)10(17)13-4-3-8(15)12-5-6-18/h9,14,16,18H,3-7H2,1-2H3,(H,12,15)(H,13,17)/t9-/m0/s1
ChEBI InChIKey Value  ZNXZGRMVNNHPCA-VIFPVBQESA-N
ChEBI Compound Name  pantetheine
ChEBI SMILES Value  CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCS
ChEBI Substance ID  8144916
ChEBI URL  ChEBI:16753
ChemSpider ID  388453
Ontomatica Chemical Accession Key (OnChAKey)  ZNXZGRMVNNHPCA_VIFPVBQESA_N_000_000000
PubChem Compound ID  439322