Select any link to see items in a related category.

more general categories	information about this item
04. Bioactive Capabilities of Specific Chemicals	04. Bioactive Capabilities of Specific Chemicals
Oxidoreductases [EC:1] (1697)
Acting on CH or CH2 groups [EC:1.17] (49)
With other acceptors [EC:1.17.99] (17)
4-methylphenol dehydrogenase (hydroxylating) [EC:1.17.99.1] (3)	p-cresol [CHEBI:17847] (1)
Lyases [EC:4] (743)
Carbon-carbon lyases [EC:4.1] (299)
Carboxy-Lyases [EC:4.1.1] (172)
4-hydroxyphenylacetate decarboxylase [EC:4.1.1.83] (4)	p-cresol [CHEBI:17847] (1)
Other Carbon-Carbon Lyases [EC:4.1.99] (34)
2-iminoacetate synthase [EC:4.1.99.19] (7)	p-cresol [CHEBI:17847] (1)
08. Chemical Category	08. Chemical Category
main group molecular entity [CHEBI:33579] (25650)
s-block molecular entity [CHEBI:33674] (7287)
hydrogen molecular entity [CHEBI:33608] (6932)
hydroxides [CHEBI:24651] (5641)
organic hydroxy compound [CHEBI:33822] (3050)
phenols [CHEBI:33853] (868)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
p-block molecular entity [CHEBI:33675] (25343)
chalcogen molecular entity [CHEBI:33304] (15225)
oxygen molecular entity [CHEBI:25806] (14414)
hydroxides [CHEBI:24651] (5641)
organic hydroxy compound [CHEBI:33822] (3050)
phenols [CHEBI:33853] (868)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
carbon group molecular entity [CHEBI:33582] (23847)
organic molecular entity [CHEBI:50860] (23769)
organic hydroxy compound [CHEBI:33822] (3050)
phenols [CHEBI:33853] (868)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
carbocyclic compound [CHEBI:33598] (1130)
benzenoid aromatic compound [CHEBI:33836] (730)
benzenes [CHEBI:22712] (386)
toluenes [CHEBI:27024] (18)
hydroxytoluene [CHEBI:24751] (6)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
organic aromatic compound [CHEBI:33659] (3593)
benzenoid aromatic compound [CHEBI:33836] (730)
benzenes [CHEBI:22712] (386)
toluenes [CHEBI:27024] (18)
hydroxytoluene [CHEBI:24751] (6)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
phenols [CHEBI:33853] (868)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
polyatomic entity [CHEBI:36357] (18777)
molecule [CHEBI:25367] (11520)
cyclic compound [CHEBI:33595] (7817)
homocyclic compound [CHEBI:33597] (1134)
carbocyclic compound [CHEBI:33598] (1130)
benzenoid aromatic compound [CHEBI:33836] (730)
benzenes [CHEBI:22712] (386)
toluenes [CHEBI:27024] (18)
hydroxytoluene [CHEBI:24751] (6)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
aromatic compound [CHEBI:33655] (3799)
organic aromatic compound [CHEBI:33659] (3593)
benzenoid aromatic compound [CHEBI:33836] (730)
benzenes [CHEBI:22712] (386)
toluenes [CHEBI:27024] (18)
hydroxytoluene [CHEBI:24751] (6)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
phenols [CHEBI:33853] (868)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
organic cyclic compound [CHEBI:33832] (7633)
carbocyclic compound [CHEBI:33598] (1130)
benzenoid aromatic compound [CHEBI:33836] (730)
benzenes [CHEBI:22712] (386)
toluenes [CHEBI:27024] (18)
hydroxytoluene [CHEBI:24751] (6)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
organic aromatic compound [CHEBI:33659] (3593)
benzenoid aromatic compound [CHEBI:33836] (730)
benzenes [CHEBI:22712] (386)
toluenes [CHEBI:27024] (18)
hydroxytoluene [CHEBI:24751] (6)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
phenols [CHEBI:33853] (868)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
carbocyclic compound [CHEBI:33598] (1130)
benzenoid aromatic compound [CHEBI:33836] (730)
benzenes [CHEBI:22712] (386)
toluenes [CHEBI:27024] (18)
hydroxytoluene [CHEBI:24751] (6)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
organic aromatic compound [CHEBI:33659] (3593)
benzenoid aromatic compound [CHEBI:33836] (730)
benzenes [CHEBI:22712] (386)
toluenes [CHEBI:27024] (18)
hydroxytoluene [CHEBI:24751] (6)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
phenols [CHEBI:33853] (868)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
heteroatomic molecular entity [CHEBI:37577] (13672)
hydroxides [CHEBI:24651] (5641)
organic hydroxy compound [CHEBI:33822] (3050)
phenols [CHEBI:33853] (868)
cresol [CHEBI:25399] (3)	p-cresol [CHEBI:17847] (1)
ChEBI Compound Accession Identifier:	[CHEBI:17847]
ChEBI Compound Description:	null
ChEBI Compound Identification Number:	17847
ChEBI InChI Value:	InChI=1S/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3
ChEBI InChIKey Value:	IWDCLRJOBJJRNH-UHFFFAOYSA-N
ChEBI Compound Name:	p-cresol
ChEBI SMILES Value:	Cc1ccc(O)cc1
ChEBI Substance ID:	8144569
ChEBI URL:	ChEBI:17847
ChemSpider ID:	13839082
Ontomatica Chemical Accession Key (OnChAKey):	IWDCLRJOBJJRNH_UHFFFAOYSA_N_000_000000
PubChem Compound ID:	2879