Item 27 of 31 (back to results) previous next DIBOA A lactol that consists of 1,4-benzoxazine bearing two hydroxy substituents at positions 2 and 4 as well as a keto group at position 3.

Current search: 04. Bioactive Capabilities of Specific Chemicals : Oxidoreductases [EC:1] > Acting on paired donors, with incorporation or reduction of molecular oxygen [EC:1.14] > With NADH or NADPH as one donor, and incorporation of one atom of oxygen [EC:1.14.13] × 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   toxin [CHEBI:27026] (45)   phytotoxin [CHEBI:38231] (17)   DIBOA [CHEBI:63558] (1)  allelochemical [CHEBI:62215] (3)   DIBOA [CHEBI:63558] (1) 04. Bioactive Capabilities of Specific Chemicals   04. Bioactive Capabilities of Specific Chemicals  Oxidoreductases [EC:1] (1697)   Acting on paired donors, with incorporation or reduction of molecular oxygen [EC:1.14] (587)   With NADH or NADPH as one donor, and incorporation of one atom of oxygen [EC:1.14.13] (391)   2-hydroxy-1,4-benzoxazin-3-one monooxygenase [EC:1.14.13.140] (9)   DIBOA [CHEBI:63558] (1)  Transferases [EC:2] (1441)   Glycosyltransferases [EC:2.4] (334)   Hexosyltransferases [EC:2.4.1] (257)   2,4-dihydroxy-7-methoxy-2H-1,4-benzoxazin-3(4H)-one 2-D-glucosyltransferase [EC:2.4.1.202] (7)   DIBOA [CHEBI:63558] (1)  Hydrolases [EC:3] (824)   Glycosylases [EC:3.2] (112)   Glycosidases, i.e. enzymes hydrolysing O- and S-glycosyl compounds [EC:3.2.1] (81)   4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucosidebeta-D-glucosidase [EC:3.2.1.182] (6)   DIBOA [CHEBI:63558] (1) 05. Industrial Uses  05. Industrial Uses  pesticide [CHEBI:25944] (211)   herbicide [CHEBI:24527] (48)   DIBOA [CHEBI:63558] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   DIBOA [CHEBI:63558] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   DIBOA [CHEBI:63558] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   DIBOA [CHEBI:63558] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   DIBOA [CHEBI:63558] (1)  organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   DIBOA [CHEBI:63558] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   DIBOA [CHEBI:63558] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   DIBOA [CHEBI:63558] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   DIBOA [CHEBI:63558] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   DIBOA [CHEBI:63558] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   DIBOA [CHEBI:63558] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   DIBOA [CHEBI:63558] (1) ChEBI Compound Accession Identifier:   [CHEBI:63558] ChEBI Compound Description:   A lactol that consists of 1,4-benzoxazine bearing two hydroxy substituents at positions 2 and 4 as well as a keto group at position 3. ChEBI Compound Identification Number:   63558 ChEBI InChI Value:   InChI=1S/C8H7NO4/c10-7-8(11)13-6-4-2-1-3-5(6)9(7)12/h1-4,8,11-12H ChEBI InChIKey Value:   COVOPZQGJGUPEY-UHFFFAOYSA-N ChEBI Compound Name:   DIBOA ChEBI SMILES Value:   OC1Oc2ccccc2N(O)C1=O ChEBI Substance ID:   135610951 ChEBI URL:   ChEBI:63558 ChemSpider ID:   26511 Ontomatica Chemical Accession Key (OnChAKey):   COVOPZQGJGUPEY_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   28495