Item 4 of 22 (back to results) previous next dehydrocoformycin null

Current search: 04. Bioactive Capabilities of Specific Chemicals : Oxidoreductases [EC:1] × 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > organochalcogen compound [CHEBI:36962] > organooxygen compound [CHEBI:36963] > glycosyl compound [CHEBI:63161] × Select any link to see items in a related category. more general categories    information about this item 04. Bioactive Capabilities of Specific Chemicals   04. Bioactive Capabilities of Specific Chemicals  Oxidoreductases [EC:1] (1697)   Acting on the CH-OH group of donors [EC:1.1] (576)   With NAD or NADP as acceptor [EC:1.1.1] (507)   8-oxocoformycin reductase [EC:1.1.1.235] (5)   dehydrocoformycin [CHEBI:16299] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   N-glycosyl compound [CHEBI:21731] (294)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   N-glycosyl compound [CHEBI:21731] (294)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  carbohydrate derivative [CHEBI:63299] (2582)   N-glycosyl compound [CHEBI:21731] (294)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   N-glycosyl compound [CHEBI:21731] (294)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  carbohydrate derivative [CHEBI:63299] (2582)   N-glycosyl compound [CHEBI:21731] (294)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organonitrogen compound [CHEBI:35352] (6705)   N-glycosyl compound [CHEBI:21731] (294)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   N-glycosyl compound [CHEBI:21731] (294)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  carbohydrate derivative [CHEBI:63299] (2582)   N-glycosyl compound [CHEBI:21731] (294)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   imidazodiazepine [CHEBI:39305] (2)   coformycins [CHEBI:39304] (2)   dehydrocoformycin [CHEBI:16299] (1) ChEBI Compound Accession Identifier:   [CHEBI:16299] ChEBI Compound Description:   null ChEBI Compound Identification Number:   16299 ChEBI InChI Value:   InChI=1S/C11H14N4O5/c16-2-6-8(18)9(19)11(20-6)15-4-14-7-5(17)1-12-3-13-10(7)15/h3-4,6,8-9,11,16,18-19H,1-2H2,(H,12,13)/t6-,8-,9-,11-/m1/s1 ChEBI InChIKey Value:   PICFAMQFTUCMDC-PNHWDRBUSA-N ChEBI Compound Name:   dehydrocoformycin ChEBI SMILES Value:   OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2C(=O)CNC=Nc12 ChEBI Substance ID:   8143443 ChEBI URL:   ChEBI:16299 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   PICFAMQFTUCMDC_PNHWDRBUSA_N_000_000000 PubChem Compound ID:   439686