| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
N(omega)-phosphohypotaurocyamine(2-) [CHEBI:58652] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
N(omega)-phosphohypotaurocyamine(2-) [CHEBI:58652] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
N(omega)-phosphohypotaurocyamine(2-) [CHEBI:58652] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:58652] |
| ChEBI Compound Description: |
Dianion of N(omega)-phosphohypotaurocyamine. |
| ChEBI Compound Identification Number: |
58652 |
| ChEBI InChI Value: |
InChI=1S/C3H10N3O5PS/c4-3(6-12(7,8)9)5-1-2-13(10)11/h1-2H2,(H,10,11)(H5,4,5,6,7,8,9)/p-2 |
| ChEBI InChIKey Value: |
ZGZSALVJNJADDS-UHFFFAOYSA-L |
| ChEBI Compound Name: |
N(omega)-phosphohypotaurocyamine(2-) |
| ChEBI SMILES Value: |
[O-]S(=O)CCNC(=[NH2+])NP([O-])([O-])=O |
| ChEBI Substance ID: |
92741545 |
| ChEBI URL: |
ChEBI:58652 |
| ChemSpider ID: |
26331283 |
| Ontomatica Chemical Accession Key (OnChAKey): |
ZGZSALVJNJADDS_UHFFFAOYSA_L_000_000000 |
| PubChem Compound ID: |
45266712 |