New Search

Item 4 of 5 (back to results)
Previous previous next Next

6-pyruvoyl-5,6,7,8-tetrahydropterin
null


Current search:

04. Bioactive Capabilities of Specific Chemicals : Lyases [EC:4] > Carbon-oxygen lyases [EC:4.2]
×

Select any link to see items in a related category.

more general categories    information about this item
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Oxidoreductases [EC:1] (1697) 
 Acting on the CH-OH group of donors [EC:1.1] (576) 
 With NAD or NADP as acceptor [EC:1.1.1] (507) 
 Sepiapterin reductase (L-erythro-7,8-dihydrobiopterin forming) [EC:1.1.1.153] (7) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 6-pyruvoyltetrahydropterin 2'-reductase [EC:1.1.1.220] (5) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 Sepiapterin reductase (L-threo-7,8-dihydrobiopterin forming) [EC:1.1.1.325] (7) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 Lyases [EC:4] (743) 
 Carbon-oxygen lyases [EC:4.2] (393) 
 Acting on Phosphates [EC:4.2.3] (175) 
 6-pyruvoyltetrahydropterin synthase [EC:4.2.3.12] (4) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 pteridines [CHEBI:26373] (87) 
 pterins [CHEBI:26375] (74) 
 tetrahydropterin [CHEBI:30436] (13) 
 6-pyruvoyl-5,6,7,8-tetrahydropterin [CHEBI:17804] (1)
ChEBI Compound Accession Identifier  [CHEBI:17804]
ChEBI Compound Description  null
ChEBI Compound Identification Number  17804
ChEBI InChI Value  InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h4,12H,2H2,1H3,(H4,10,11,13,14,17)
ChEBI InChIKey Value  WBJZXBUVECZHCE-UHFFFAOYSA-N
ChEBI Compound Name  6-pyruvoyl-5,6,7,8-tetrahydropterin
ChEBI SMILES Value  CC(=O)C(=O)C1CNc2nc(N)[nH]c(=O)c2N1
ChEBI Substance ID  8145488
ChEBI URL  ChEBI:17804
ChemSpider ID  114280
Ontomatica Chemical Accession Key (OnChAKey)  WBJZXBUVECZHCE_UHFFFAOYSA_N_000_000000
PubChem Compound ID  128973