New Search

Item 4 of 9 (back to results)
Previous previous next Next

methanophenazine
null


Current search:

04. Bioactive Capabilities of Specific Chemicals : Oxidoreductases [EC:1] > Acting on hydrogen as donor [EC:1.12] > With other known acceptors [EC:1.12.98]
×

Select any link to see items in a related category.

more general categories    information about this item
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Oxidoreductases [EC:1] (1697) 
 Acting on a sulfur group of donors [EC:1.8] (62) 
 With other, known, acceptors [EC:1.8.98] (4) 
 CoB--CoM heterodisulfide reductase [EC:1.8.98.1] (4) 
 methanophenazine [CHEBI:29118] (1)
 Acting on hydrogen as donor [EC:1.12] (14) 
 With other known acceptors [EC:1.12.98] (9) 
 Methanosarcina-phenazine hydrogenase [EC:1.12.98.3] (2) 
 methanophenazine [CHEBI:29118] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenazines [CHEBI:39201] (13) 
 methanophenazine [CHEBI:29118] (1)
ChEBI Compound Accession Identifier  [CHEBI:29118]
ChEBI Compound Description  null
ChEBI Compound Identification Number  29118
ChEBI InChI Value  InChI=1S/C37H50N2O/c1-28(2)13-9-14-29(3)15-10-16-30(4)17-11-18-31(5)19-12-20-32(6)25-26-40-33-23-24-36-37(27-33)39-35-22-8-7-21-34(35)38-36/h7-8,13,15,17,19,21-24,27,32H,9-12,14,16,18,20,25-26H2,1-6H3/b29-15+,30-17+,31-19+
ChEBI InChIKey Value  VRHMBACMYZITGD-QAAQOENVSA-N
ChEBI Compound Name  methanophenazine
ChEBI SMILES Value  CC(CCOc1ccc2nc3ccccc3nc2c1)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C
ChEBI Substance ID  8145451
ChEBI URL  ChEBI:29118
ChemSpider ID  4445251
Ontomatica Chemical Accession Key (OnChAKey)  VRHMBACMYZITGD_QAAQOENVSA_N_000_000000
PubChem Compound ID  5281992