Item 6 of 7 (back to results) previous next 5-nitroanthranilate An anthranilate obtained by removal of a proton from the carboxylic acid group of 5-nitroanthranilic acid.

Current search: 04. Bioactive Capabilities of Specific Chemicals : Hydrolases [EC:3] > Acting on carbon-nitrogen bonds, other than peptide bonds [EC:3.5] > In other compounds [EC:3.5.99] × 08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367] > cyclic compound [CHEBI:33595] > aromatic compound [CHEBI:33655] > organic aromatic compound [CHEBI:33659] × Select any link to see items in a related category. more general categories    information about this item 04. Bioactive Capabilities of Specific Chemicals   04. Bioactive Capabilities of Specific Chemicals  Hydrolases [EC:3] (824)   Acting on carbon-nitrogen bonds, other than peptide bonds [EC:3.5] (303)   In other compounds [EC:3.5.99] (24)   5-nitroanthranilic acid aminohydrolase [EC:3.5.99.8] (5)   5-nitroanthranilate [CHEBI:61267] (1) 08. Chemical Category  08. Chemical Category  ion [CHEBI:24870] (4391)   anion [CHEBI:22563] (3454)   organic anion [CHEBI:25696] (3155)   carboxylic acid anion [CHEBI:29067] (1731)   monocarboxylic acid anion [CHEBI:35757] (912)   benzoates [CHEBI:22718] (87)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  polyatomic anion [CHEBI:33273] (2028)   oxoanion [CHEBI:35406] (1950)   carboxylic acid anion [CHEBI:29067] (1731)   monocarboxylic acid anion [CHEBI:35757] (912)   benzoates [CHEBI:22718] (87)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  organic ion [CHEBI:25699] (3577)   organic anion [CHEBI:25696] (3155)   carboxylic acid anion [CHEBI:29067] (1731)   monocarboxylic acid anion [CHEBI:35757] (912)   benzoates [CHEBI:22718] (87)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  polyatomic ion [CHEBI:36358] (2633)   polyatomic anion [CHEBI:33273] (2028)   oxoanion [CHEBI:35406] (1950)   carboxylic acid anion [CHEBI:29067] (1731)   monocarboxylic acid anion [CHEBI:35757] (912)   benzoates [CHEBI:22718] (87)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   oxide [CHEBI:25741] (2086)   oxoanion [CHEBI:35406] (1950)   carboxylic acid anion [CHEBI:29067] (1731)   monocarboxylic acid anion [CHEBI:35757] (912)   benzoates [CHEBI:22718] (87)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic ion [CHEBI:25699] (3577)   organic anion [CHEBI:25696] (3155)   carboxylic acid anion [CHEBI:29067] (1731)   monocarboxylic acid anion [CHEBI:35757] (912)   benzoates [CHEBI:22718] (87)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  polyatomic ion [CHEBI:36358] (2633)   polyatomic anion [CHEBI:33273] (2028)   oxoanion [CHEBI:35406] (1950)   carboxylic acid anion [CHEBI:29067] (1731)   monocarboxylic acid anion [CHEBI:35757] (912)   benzoates [CHEBI:22718] (87)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxide [CHEBI:25741] (2086)   oxoanion [CHEBI:35406] (1950)   carboxylic acid anion [CHEBI:29067] (1731)   monocarboxylic acid anion [CHEBI:35757] (912)   benzoates [CHEBI:22718] (87)   aminobenzoate [CHEBI:22494] (10)   anthranilate [CHEBI:16567] (2)   5-nitroanthranilate [CHEBI:61267] (1) ChEBI Compound Accession Identifier:   [CHEBI:61267] ChEBI Compound Description:   An anthranilate obtained by removal of a proton from the carboxylic acid group of 5-nitroanthranilic acid. ChEBI Compound Identification Number:   61267 ChEBI InChI Value:   InChI=1S/C7H6N2O4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,8H2,(H,10,11)/p-1 ChEBI InChIKey Value:   RUCHWTKMOWXHLU-UHFFFAOYSA-M ChEBI Compound Name:   5-nitroanthranilate ChEBI SMILES Value:   Nc1ccc(cc1C([O-])=O)[N+]([O-])=O ChEBI Substance ID:   111978191 ChEBI URL:   ChEBI:61267 ChemSpider ID:   5416232 Ontomatica Chemical Accession Key (OnChAKey):   RUCHWTKMOWXHLU_UHFFFAOYSA_M_000_000000 PubChem Compound ID:   7060140