Item 1 of 1 (back to results) desferrioxamine B mesylate null

Current search: 09. Chemical Capabilities: ligand [CHEBI:52214] > chelator [CHEBI:38161] > iron chelator [CHEBI:38157] > desferrioxamine B mesylate [CHEBI:31460] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   protective agent [CHEBI:50267] (74)   antidote [CHEBI:50247] (10)   desferrioxamine B mesylate [CHEBI:31460] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   methanesulfonates [CHEBI:48544] (33)   methanesulfonate salt [CHEBI:38037] (28)   desferrioxamine B mesylate [CHEBI:31460] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   methanesulfonates [CHEBI:48544] (33)   methanesulfonate salt [CHEBI:38037] (28)   desferrioxamine B mesylate [CHEBI:31460] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   methanesulfonates [CHEBI:48544] (33)   methanesulfonate salt [CHEBI:38037] (28)   desferrioxamine B mesylate [CHEBI:31460] (1)  polyatomic entity [CHEBI:36357] (18777)   heteroatomic molecular entity [CHEBI:37577] (13672)   salt [CHEBI:24866] (931)   organic salt [CHEBI:24868] (775)   organosulfonate salt [CHEBI:64382] (37)   methanesulfonate salt [CHEBI:38037] (28)   desferrioxamine B mesylate [CHEBI:31460] (1) 09. Chemical Capabilities  09. Chemical Capabilities  ligand [CHEBI:52214] (33)   chelator [CHEBI:38161] (32)   iron chelator [CHEBI:38157] (9)   desferrioxamine B mesylate [CHEBI:31460] (1) ChEBI Compound Accession Identifier:   [CHEBI:31460] ChEBI Compound Description:   null ChEBI Compound Identification Number:   31460 ChEBI InChI Value:   "InChI=1S/C25H48N6O8.CH4O3S/c1-21(32)29(37)18-9-3-6-16-27-22(33)12-14-25(36)31(39)20-10-4-7-17-28-23(34)11-13-24(35)30(38)19-8-2-5-15-26;1-5(2,3)4/h37-39H,2-20,26H2,1H3,(H,27,33)(H,28,34);1H3,(H,2,3,4)" ChEBI InChIKey Value:   IDDIJAWJANBQLJ-UHFFFAOYSA-N ChEBI Compound Name:   desferrioxamine B mesylate ChEBI SMILES Value:   [H+].CS([O-])(=O)=O.CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN ChEBI Substance ID:   50139261 ChEBI URL:   ChEBI:31460 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   IDDIJAWJANBQLJ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   24883429