Item 1 of 1 (back to results) 2,6-dimethyl-5-methylenehept-2-enoic acid A monocarboxylic acid consisting of 2-heptenoic acid having methyl substituents at the 2- and 6-positions as well as a methylene group at position 5.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > organochalcogen compound [CHEBI:36962] > organooxygen compound [CHEBI:36963] > carbon oxoacid [CHEBI:35605] > carboxylic acid [CHEBI:33575] > monocarboxylic acid [CHEBI:25384] > 2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] × Select any link to see items in a related category. more general categories    information about this item 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,6-dimethyl-5-methylenehept-2-enoic acid [CHEBI:36153] (3) ChEBI Compound Accession Identifier:   [CHEBI:36153] ChEBI Compound Description:   A monocarboxylic acid consisting of 2-heptenoic acid having methyl substituents at the 2- and 6-positions as well as a methylene group at position 5. ChEBI Compound Identification Number:   36153 ChEBI InChI Value:   InChI=1S/C10H16O2/c1-7(2)8(3)5-6-9(4)10(11)12/h6-7H,3,5H2,1-2,4H3,(H,11,12) ChEBI InChIKey Value:   HZNKOKJSWBRPRJ-UHFFFAOYSA-N ChEBI Compound Name:   2,6-dimethyl-5-methylenehept-2-enoic acid ChEBI SMILES Value:   [H]C(CC(=C)C(C)C)=C(C)C(O)=O ChEBI Substance ID:   121269898 ChEBI URL:   ChEBI:36153 ChemSpider ID:   4445254 Ontomatica Chemical Accession Key (OnChAKey):   HZNKOKJSWBRPRJ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   5281995