more general categories |
information about this item |
|
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7,8-dihydropteroic acid [CHEBI:4581] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:4581] |
ChEBI Compound Description: |
A pteroic acid derivative arising from formal hydrogenation of the 7,8-double bond of pteroic acid. |
ChEBI Compound Identification Number: |
4581 |
ChEBI InChI Value: |
InChI=1S/C14H14N6O3/c15-14-19-11-10(12(21)20-14)18-9(6-17-11)5-16-8-3-1-7(2-4-8)13(22)23/h1-4,16H,5-6H2,(H,22,23)(H4,15,17,19,20,21) |
ChEBI InChIKey Value: |
WBFYVDCHGVNRBH-UHFFFAOYSA-N |
ChEBI Compound Name: |
7,8-dihydropteroic acid |
ChEBI SMILES Value: |
Nc1nc2NCC(CNc3ccc(cc3)C(O)=O)=Nc2c(=O)[nH]1 |
ChEBI Substance ID: |
17425134 |
ChEBI URL: |
ChEBI:4581 |
ChemSpider ID: |
165 |
Ontomatica Chemical Accession Key (OnChAKey): |
WBFYVDCHGVNRBH_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
170 |