Item 1 of 1 (back to results) pacific blue A hydroxycoumarin having the hydroxy group located at position 7 and bearing two fluoro substituents at positions 6 and 8 as well as a carboxy group at position 3. A fluorescent dye of excitation wavelength 403 nm and emission wavelength 455 nm.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > oxygen molecular entity [CHEBI:25806] > organooxygen compound [CHEBI:36963] > carbon oxoacid [CHEBI:35605] > carboxylic acid [CHEBI:33575] > monocarboxylic acid [CHEBI:25384] > pacific blue [CHEBI:63236] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  dye [CHEBI:37958] (446)   fluorescent dye [CHEBI:51121] (410)   fluorochrome [CHEBI:51217] (404)   pacific blue [CHEBI:63236] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   pacific blue [CHEBI:63236] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   pacific blue [CHEBI:63236] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   pacific blue [CHEBI:63236] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   chromenone [CHEBI:38445] (61)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   coumarins [CHEBI:23403] (50)   hydroxycoumarin [CHEBI:37912] (26)   pacific blue [CHEBI:63236] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pacific blue [CHEBI:63236] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   pacific blue [CHEBI:63236] (1) ChEBI Compound Accession Identifier:   [CHEBI:63236] ChEBI Compound Description:   A hydroxycoumarin having the hydroxy group located at position 7 and bearing two fluoro substituents at positions 6 and 8 as well as a carboxy group at position 3. A fluorescent dye of excitation wavelength 403 nm and emission wavelength 455 nm. ChEBI Compound Identification Number:   63236 ChEBI InChI Value:   InChI=1S/C10H4F2O5/c11-5-2-3-1-4(9(14)15)10(16)17-8(3)6(12)7(5)13/h1-2,13H,(H,14,15) ChEBI InChIKey Value:   VYNDHICBIRRPFP-UHFFFAOYSA-N ChEBI Compound Name:   pacific blue ChEBI SMILES Value:   OC(=O)c1cc2cc(F)c(O)c(F)c2oc1=O ChEBI Substance ID:   135610356 ChEBI URL:   ChEBI:63236 ChemSpider ID:   13906206 Ontomatica Chemical Accession Key (OnChAKey):   VYNDHICBIRRPFP_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   18942321