Select any link to see items in a related category.

more general categories	information about this item
03. Biological Effects of Specific Chemicals	03. Biological Effects of Specific Chemicals
pharmacological uses [CHEBI:52210] (736)
neurotransmitter agent [CHEBI:35942] (471)
adrenergic agent [CHEBI:37962] (143)
alpha-adrenergic drug [CHEBI:48539] (2)	zotepine [CHEBI:32316] (1)
serotonergic drug [CHEBI:48278] (109)	zotepine [CHEBI:32316] (1)
05. Industrial Uses	05. Industrial Uses
pharmaceutical [CHEBI:52217] (1978)
drug [CHEBI:23888] (1930)
central nervous system drug [CHEBI:35470] (217)
psychotropic drug [CHEBI:35471] (130)
tranquilizing drug [CHEBI:35473] (83)
antipsychotic agent [CHEBI:35476] (51)
second generation antipsychotic [CHEBI:65191] (11)	zotepine [CHEBI:32316] (1)
08. Chemical Category	08. Chemical Category
main group molecular entity [CHEBI:33579] (25650)
p-block molecular entity [CHEBI:33675] (25343)
pnictogen molecular entity [CHEBI:33302] (10027)
nitrogen molecular entity [CHEBI:51143] (7930)
organonitrogen compound [CHEBI:35352] (6705)
organic amino compound [CHEBI:50047] (2472)
tertiary amino compound [CHEBI:50996] (199)	zotepine [CHEBI:32316] (1)
chalcogen molecular entity [CHEBI:33304] (15225)
sulfur molecular entity [CHEBI:26835] (1541)
organosulfur compound [CHEBI:33261] (1005)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organochalcogen compound [CHEBI:36962] (11874)
organosulfur compound [CHEBI:33261] (1005)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
carbon group molecular entity [CHEBI:33582] (23847)
organic molecular entity [CHEBI:50860] (23769)
heteroorganic entity [CHEBI:33285] (15197)
organic heterocyclic compound [CHEBI:24532] (5243)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organonitrogen compound [CHEBI:35352] (6705)
organic amino compound [CHEBI:50047] (2472)
tertiary amino compound [CHEBI:50996] (199)	zotepine [CHEBI:32316] (1)
organochalcogen compound [CHEBI:36962] (11874)
organosulfur compound [CHEBI:33261] (1005)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic amino compound [CHEBI:50047] (2472)
tertiary amino compound [CHEBI:50996] (199)	zotepine [CHEBI:32316] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic polycyclic compound [CHEBI:51958] (1654)
organic tricyclic compound [CHEBI:51959] (755)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
polyatomic entity [CHEBI:36357] (18777)
molecule [CHEBI:25367] (11520)
cyclic compound [CHEBI:33595] (7817)
polycyclic compound [CHEBI:33635] (4078)
heteropolycyclic compound [CHEBI:33671] (2613)
heterotricyclic compound [CHEBI:36688] (541)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic polycyclic compound [CHEBI:51958] (1654)
organic tricyclic compound [CHEBI:51959] (755)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic polycyclic compound [CHEBI:51958] (1654)
organic tricyclic compound [CHEBI:51959] (755)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
heterocyclic compound [CHEBI:5686] (5275)
organic heterocyclic compound [CHEBI:24532] (5243)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
heteropolycyclic compound [CHEBI:33671] (2613)
heterotricyclic compound [CHEBI:36688] (541)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
organic polycyclic compound [CHEBI:51958] (1654)
organic tricyclic compound [CHEBI:51959] (755)
organic heterotricyclic compound [CHEBI:26979] (541)
dibenzothiepine [CHEBI:38924] (5)	zotepine [CHEBI:32316] (1)
ChEBI Compound Accession Identifier:	[CHEBI:32316]
ChEBI Compound Description:	null
ChEBI Compound Identification Number:	32316
ChEBI InChI Value:	InChI=1S/C18H18ClNOS/c1-20(2)9-10-21-16-11-13-5-3-4-6-17(13)22-18-8-7-14(19)12-15(16)18/h3-8,11-12H,9-10H2,1-2H3
ChEBI InChIKey Value:	HDOZVRUNCMBHFH-UHFFFAOYSA-N
ChEBI Compound Name:	zotepine
ChEBI SMILES Value:	CN(C)CCOC1=Cc2ccccc2Sc2ccc(Cl)cc12
ChEBI Substance ID:	49658668
ChEBI URL:	ChEBI:32316
ChemSpider ID:	5534
Ontomatica Chemical Accession Key (OnChAKey):	HDOZVRUNCMBHFH_UHFFFAOYSA_N_000_000000
PubChem Compound ID:	5736