Select any link to see items in a related category.

more general categories	information about this item
03. Biological Effects of Specific Chemicals	03. Biological Effects of Specific Chemicals
antimicrobial agent [CHEBI:33281] (927)
fungicide [CHEBI:24127] (52)	isoprothiolane [CHEBI:6047] (1)
05. Industrial Uses	05. Industrial Uses
pesticide [CHEBI:25944] (211)
insecticide [CHEBI:24852] (37)	isoprothiolane [CHEBI:6047] (1)
08. Chemical Category	08. Chemical Category
main group molecular entity [CHEBI:33579] (25650)
p-block molecular entity [CHEBI:33675] (25343)
chalcogen molecular entity [CHEBI:33304] (15225)
oxygen molecular entity [CHEBI:25806] (14414)
organooxygen compound [CHEBI:36963] (11352)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
malonate ester [CHEBI:38083] (5)	isoprothiolane [CHEBI:6047] (1)
sulfur molecular entity [CHEBI:26835] (1541)
organosulfur compound [CHEBI:33261] (1005)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organochalcogen compound [CHEBI:36962] (11874)
organosulfur compound [CHEBI:33261] (1005)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organooxygen compound [CHEBI:36963] (11352)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
malonate ester [CHEBI:38083] (5)	isoprothiolane [CHEBI:6047] (1)
carbon group molecular entity [CHEBI:33582] (23847)
organic molecular entity [CHEBI:50860] (23769)
heteroorganic entity [CHEBI:33285] (15197)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organochalcogen compound [CHEBI:36962] (11874)
organosulfur compound [CHEBI:33261] (1005)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organooxygen compound [CHEBI:36963] (11352)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
malonate ester [CHEBI:38083] (5)	isoprothiolane [CHEBI:6047] (1)
ester [CHEBI:35701] (3370)
carboxylic ester [CHEBI:33308] (1495)
malonate ester [CHEBI:38083] (5)	isoprothiolane [CHEBI:6047] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organic oxo compound [CHEBI:36587] (5932)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
malonate ester [CHEBI:38083] (5)	isoprothiolane [CHEBI:6047] (1)
polyatomic entity [CHEBI:36357] (18777)
molecule [CHEBI:25367] (11520)
cyclic compound [CHEBI:33595] (7817)
monocyclic compound [CHEBI:33661] (2007)
heteromonocyclic compound [CHEBI:33670] (2004)
organic heteromonocyclic compound [CHEBI:25693] (2004)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
heterocyclic compound [CHEBI:5686] (5275)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
heteromonocyclic compound [CHEBI:33670] (2004)
organic heteromonocyclic compound [CHEBI:25693] (2004)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
dithiolanes [CHEBI:39192] (10)	isoprothiolane [CHEBI:6047] (1)
organic oxo compound [CHEBI:36587] (5932)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
malonate ester [CHEBI:38083] (5)	isoprothiolane [CHEBI:6047] (1)
ChEBI Compound Accession Identifier:	[CHEBI:6047]
ChEBI Compound Description:	null
ChEBI Compound Identification Number:	6047
ChEBI InChI Value:	InChI=1S/C12H18O4S2/c1-7(2)15-10(13)9(11(14)16-8(3)4)12-17-5-6-18-12/h7-8H,5-6H2,1-4H3
ChEBI InChIKey Value:	UFHLMYOGRXOCSL-UHFFFAOYSA-N
ChEBI Compound Name:	isoprothiolane
ChEBI SMILES Value:	CC(C)OC(=O)C(C(=O)OC(C)C)=C1SCCS1
ChEBI Substance ID:	24712289
ChEBI URL:	ChEBI:6047
ChemSpider ID:	36283
Ontomatica Chemical Accession Key (OnChAKey):	UFHLMYOGRXOCSL_UHFFFAOYSA_N_000_000000
PubChem Compound ID:	39681