Item 1 of 1 (back to results) L-homocysteine thiolactone A thiolactone arising from formal condensation of the mercapto and carboxylic acid groups of L-homocysteine.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > sulfur molecular entity [CHEBI:26835] > organosulfur compound [CHEBI:33261] > organosulfur heterocyclic compound [CHEBI:38106] > thiolactone [CHEBI:60317] × Select any link to see items in a related category. more general categories    information about this item 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  ester [CHEBI:35701] (3370)   thiocarboxylic ester [CHEBI:26959] (311)   thioester [CHEBI:51277] (307)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   thiolactone [CHEBI:60317] (1)   L-homocysteine thiolactone [CHEBI:60315] (1) ChEBI Compound Accession Identifier:   [CHEBI:60315] ChEBI Compound Description:   A thiolactone arising from formal condensation of the mercapto and carboxylic acid groups of L-homocysteine. ChEBI Compound Identification Number:   60315 ChEBI InChI Value:   InChI=1S/C4H7NOS/c5-3-1-2-7-4(3)6/h3H,1-2,5H2/t3-/m0/s1 ChEBI InChIKey Value:   KIWQWJKWBHZMDT-VKHMYHEASA-N ChEBI Compound Name:   L-homocysteine thiolactone ChEBI SMILES Value:   N[C@H]1CCSC1=O ChEBI Substance ID:   99365008 ChEBI URL:   ChEBI:60315 ChemSpider ID:   118559 Ontomatica Chemical Accession Key (OnChAKey):   KIWQWJKWBHZMDT_VKHMYHEASA_N_000_000000 PubChem Compound ID:   134505