New Search

Item 1 of 4 (back to results)
next Next

heliosupine
An azabicycloalkane compound having angelyloxy and echimidinyloxymethyl substituents attached to the ring system.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 ester [CHEBI:35701] (3370) 
 diester [CHEBI:51307] (28) 
 heliosupine [CHEBI:5641] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 heliosupine [CHEBI:5641] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 short-chain fatty acid [CHEBI:26666] (31) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
 branched-chain fatty acid [CHEBI:35819] (63) 
 methyl-branched fatty acid [CHEBI:62499] (24) 
 2-methylbut-2-enoic acid [CHEBI:36432] (4) 
 heliosupine [CHEBI:5641] (1)
ChEBI Compound Accession Identifier  [CHEBI:5641]
ChEBI Compound Description  An azabicycloalkane compound having angelyloxy and echimidinyloxymethyl substituents attached to the ring system.
ChEBI Compound Identification Number  5641
ChEBI InChI Value  InChI=1S/C20H31NO7/c1-6-12(2)17(23)28-15-8-10-21-9-7-14(16(15)21)11-27-18(24)20(26,13(3)22)19(4,5)25/h6-7,13,15-16,22,25-26H,8-11H2,1-5H3/b12-6-/t13-,15-,16+,20+/m0/s1
ChEBI InChIKey Value  HRSGCYGUWHGOPY-UKLMUADPSA-N
ChEBI Compound Name  heliosupine
ChEBI SMILES Value  [H][C@@]12[C@H](CCN1CC=C2COC(=O)[C@](O)([C@H](C)O)C(C)(C)O)OC(=O)C(\C)=C/C
ChEBI Substance ID  85164711
ChEBI URL  ChEBI:5641
ChemSpider ID  4445047
Ontomatica Chemical Accession Key (OnChAKey)  HRSGCYGUWHGOPY_UKLMUADPSA_N_000_000000
PubChem Compound ID  5281732