New Search

Item 1 of 1 (back to results)

6-(3-hydroxypropyl)thymine
A pyrimidone that is thymine in which the hydrogen at position 6 is substituted by a 3-hydroxypropyl group.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 primary alcohol [CHEBI:15734] (167) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 primary alcohol [CHEBI:15734] (167) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 primary alcohol [CHEBI:15734] (167) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 pyrimidone [CHEBI:38337] (53) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 primary alcohol [CHEBI:15734] (167) 
 6-(3-hydroxypropyl)thymine [CHEBI:43299] (1)
ChEBI Compound Accession Identifier  [CHEBI:43299]
ChEBI Compound Description  A pyrimidone that is thymine in which the hydrogen at position 6 is substituted by a 3-hydroxypropyl group.
ChEBI Compound Identification Number  43299
ChEBI InChI Value  InChI=1S/C8H12N2O3/c1-5-6(3-2-4-11)9-8(13)10-7(5)12/h11H,2-4H2,1H3,(H2,9,10,12,13)
ChEBI InChIKey Value  OIEJBPVNLZZLGQ-UHFFFAOYSA-N
ChEBI Compound Name  6-(3-hydroxypropyl)thymine
ChEBI SMILES Value  Cc1c(CCCO)[nH]c(=O)[nH]c1=O
ChEBI Substance ID  125258696
ChEBI URL  ChEBI:43299
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  OIEJBPVNLZZLGQ_UHFFFAOYSA_N_000_000000
PubChem Compound ID  1865