New Search

Item 1 of 1 (back to results)

microthecin
A metabolite isolated from morels (e.g. Morchella costata) and red algae (e.g. Gracilariopsis lemaneiformis).


Current search:

Select any link to see items in a related category.

more general categories    information about this item
04. Bioactive Capabilities of Specific Chemicals  
04. Bioactive Capabilities of Specific Chemicals
 Lyases [EC:4] (743) 
 Carbon-oxygen lyases [EC:4.2] (393) 
 Hydro-Lyases [EC:4.2.1] (219) 
 Aldos-2-ulose dehydratase [EC:4.2.1.110] (5) 
 microthecin [CHEBI:51835] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 microthecin [CHEBI:51835] (1)
ChEBI Compound Accession Identifier  [CHEBI:51835]
ChEBI Compound Description  A metabolite isolated from morels (e.g. Morchella costata) and red algae (e.g. Gracilariopsis lemaneiformis).
ChEBI Compound Identification Number  51835
ChEBI InChI Value  InChI=1S/C6H8O4/c7-4-6(9)5(8)2-1-3-10-6/h1-2,7,9H,3-4H2
ChEBI InChIKey Value  FUJVJJBVXLPRQJ-UHFFFAOYSA-N
ChEBI Compound Name  microthecin
ChEBI SMILES Value  OCC1(O)OCC=CC1=O
ChEBI Substance ID  57269730
ChEBI URL  ChEBI:51835
ChemSpider ID  8305538
Ontomatica Chemical Accession Key (OnChAKey)  FUJVJJBVXLPRQJ_UHFFFAOYSA_N_000_000000
PubChem Compound ID  10130020