Item 1 of 2 (back to results) next 4a,5-dihydroriboflavin Riboflavin in which the double bond between positions 4a and 5 has been reduced to a single bond.

Current search: 08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367] > cyclic compound [CHEBI:33595] > heterocyclic compound [CHEBI:5686] > heteropolycyclic compound [CHEBI:33671] > organic heteropolycyclic compound [CHEBI:38166] > organic heterotricyclic compound [CHEBI:26979] > benzopteridine [CHEBI:38925] > flavin [CHEBI:30527] > dihydroriboflavins [CHEBI:15031] × Select any link to see items in a related category. more general categories    information about this item 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   benzopteridine [CHEBI:38925] (18)   flavin [CHEBI:30527] (12)   dihydroriboflavins [CHEBI:15031] (2)   4a,5-dihydroriboflavin [CHEBI:8798] (1) ChEBI Compound Accession Identifier:   [CHEBI:8798] ChEBI Compound Description:   Riboflavin in which the double bond between positions 4a and 5 has been reduced to a single bond. ChEBI Compound Identification Number:   8798 ChEBI InChI Value:   InChI=1S/C17H22N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-14,18,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,13?,14-/m0/s1 ChEBI InChIKey Value:   UTKDOUCGQVLJIN-PIGZVRMJSA-N ChEBI Compound Name:   4a,5-dihydroriboflavin ChEBI SMILES Value:   Cc1cc2NC3C(=O)NC(=O)N=C3N(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1C ChEBI Substance ID:   49658634 ChEBI URL:   ChEBI:8798 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   UTKDOUCGQVLJIN_PIGZVRMJSA_N_000_000000 PubChem Compound ID:   45480537