New Search

Item 2 of 2 (back to results)
Previous previous

clopidogrel
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 hematologic agent [CHEBI:50248] (64) 
 anticoagulant [CHEBI:50249] (29) 
 clopidogrel [CHEBI:37941] (1)
 platelet aggregation inhibitor [CHEBI:50427] (39) 
 clopidogrel [CHEBI:37941] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 clopidogrel [CHEBI:37941] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 clopidogrel [CHEBI:37941] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 clopidogrel [CHEBI:37941] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienopyridine [CHEBI:37942] (2) 
 clopidogrel [CHEBI:37941] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 clopidogrel [CHEBI:37941] (1)
ChEBI Compound Accession Identifier  [CHEBI:37941]
ChEBI Compound Description  null
ChEBI Compound Identification Number  37941
ChEBI InChI Value  InChI=1S/C16H16ClNO2S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14/h2-5,7,9,15H,6,8,10H2,1H3/t15-/m0/s1
ChEBI InChIKey Value  GKTWGGQPFAXNFI-HNNXBMFYSA-N
ChEBI Compound Name  clopidogrel
ChEBI SMILES Value  COC(=O)[C@@H](N1CCc2sccc2C1)c1ccccc1Cl
ChEBI Substance ID  50139266
ChEBI URL  ChEBI:37941
ChemSpider ID  54632
Ontomatica Chemical Accession Key (OnChAKey)  GKTWGGQPFAXNFI_HNNXBMFYSA_N_000_000000
PubChem Compound ID  60606