Item 2 of 11 (back to results) previous next biotin An organic heterobicyclic compound that consists of 2-oxohexahydro-1H-thieno[3,4-d]imidazole having a valeric acid substituent attached to the tetrahydrothiophene ring. The parent of the class of biotins.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > sulfur molecular entity [CHEBI:26835] > organosulfur compound [CHEBI:33261] > organosulfur heterocyclic compound [CHEBI:38106] > thiabicycloalkane [CHEBI:38297] × Select any link to see items in a related category. more general categories    information about this item 01. Food Nutrient & Dietary Chemicals  01. Food Nutrient & Dietary Chemicals  Vitamins [ChEBI:26848] (59)   Water soluble vitamins [ChEBI:27314] (25)   Vitamin B-7 (vitamin H) (biotin) [ChEBI:15956] (1) 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   cofactor [CHEBI:23357] (40)   coenzyme [CHEBI:23354] (24)   biotin [CHEBI:15956] (1)  prosthetic group [CHEBI:26348] (10)   biotin [CHEBI:15956] (1)  physiological uses [CHEBI:52211] (63)   vitamin [CHEBI:33229] (15)   water-soluble vitamin [CHEBI:27314] (7)   biotin [CHEBI:15956] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   nutraceutical [CHEBI:50733] (39)   biotin [CHEBI:15956] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   ureas [CHEBI:47857] (101)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  thiabicycloalkane [CHEBI:38297] (11)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   biotins [CHEBI:51570] (4)   biotin [CHEBI:15956] (1) ChEBI Compound Accession Identifier:   [CHEBI:15956] ChEBI Compound Description:   An organic heterobicyclic compound that consists of 2-oxohexahydro-1H-thieno[3,4-d]imidazole having a valeric acid substituent attached to the tetrahydrothiophene ring. The parent of the class of biotins. ChEBI Compound Identification Number:   15956 ChEBI InChI Value:   InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1 ChEBI InChIKey Value:   YBJHBAHKTGYVGT-ZKWXMUAHSA-N ChEBI Compound Name:   biotin ChEBI SMILES Value:   [H][C@]12CS[C@@H](CCCCC(O)=O)[C@@]1([H])NC(=O)N2 ChEBI Substance ID:   8143739 ChEBI URL:   ChEBI:15956 ChemSpider ID:   149962 Ontomatica Chemical Accession Key (OnChAKey):   YBJHBAHKTGYVGT_ZKWXMUAHSA_N_000_000000 PubChem Compound ID:   171548