New Search

Item 2 of 5 (back to results)
Previous previous next Next

dothiepin
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 tricyclic antidepressant [CHEBI:36809] (22) 
 dothiepin [CHEBI:36798] (3)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 tricyclic antidepressant [CHEBI:36809] (22) 
 dothiepin [CHEBI:36798] (3)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 tricyclic antidepressant [CHEBI:36809] (22) 
 dothiepin [CHEBI:36798] (3)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 dibenzothiepine [CHEBI:38924] (5) 
 dothiepin [CHEBI:36798] (3)
 tricyclic antidepressant [CHEBI:36809] (22) 
 dothiepin [CHEBI:36798] (3)
ChEBI Compound Accession Identifier  [CHEBI:36798]
ChEBI Compound Description  null
ChEBI Compound Identification Number  36798
ChEBI InChI Value  InChI=1S/C19H21NS/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3
ChEBI InChIKey Value  PHTUQLWOUWZIMZ-UHFFFAOYSA-N
ChEBI Compound Name  dothiepin
ChEBI SMILES Value  [H]C(CCN(C)C)=C1c2ccccc2CSc2ccccc12
ChEBI Substance ID  17425387
ChEBI URL  ChEBI:36798
ChemSpider ID  3043
Ontomatica Chemical Accession Key (OnChAKey)  PHTUQLWOUWZIMZ_UHFFFAOYSA_N_000_000000
PubChem Compound ID  3155