New Search

Item 2 of 198 (back to results)
Previous previous next Next

anthracene-1,8,9-triol
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 phenols [CHEBI:33853] (868) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 phenols [CHEBI:33853] (868) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 phenols [CHEBI:33853] (868) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 phenols [CHEBI:33853] (868) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 anthracenol [CHEBI:37507] (4) 
 anthracenetriol [CHEBI:37505] (2) 
 anthracene-1,8,9-triol [CHEBI:2756] (1)
ChEBI Compound Accession Identifier  [CHEBI:2756]
ChEBI Compound Description  null
ChEBI Compound Identification Number  2756
ChEBI InChI Value  InChI=1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-7,15-17H
ChEBI InChIKey Value  YUTJCNNFTOIOGT-UHFFFAOYSA-N
ChEBI Compound Name  anthracene-1,8,9-triol
ChEBI SMILES Value  Oc1cccc2cc3cccc(O)c3c(O)c12
ChEBI Substance ID  17487272
ChEBI URL  ChEBI:2756
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  YUTJCNNFTOIOGT_UHFFFAOYSA_N_000_000000
PubChem Compound ID  10187