Item 2 of 198 (back to results) previous next anthracene-1,8,9-triol null

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > carbon group molecular entity [CHEBI:33582] > organic molecular entity [CHEBI:50860] > organic molecule [CHEBI:72695] > organic cyclic compound [CHEBI:33832] > organic polycyclic compound [CHEBI:51958] > organic tricyclic compound [CHEBI:51959] > carbotricyclic compound [CHEBI:38032] × Select any link to see items in a related category. more general categories    information about this item 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  phenols [CHEBI:33853] (868)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  phenols [CHEBI:33853] (868)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  phenols [CHEBI:33853] (868)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  phenols [CHEBI:33853] (868)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   anthracenol [CHEBI:37507] (4)   anthracenetriol [CHEBI:37505] (2)   anthracene-1,8,9-triol [CHEBI:2756] (1) ChEBI Compound Accession Identifier:   [CHEBI:2756] ChEBI Compound Description:   null ChEBI Compound Identification Number:   2756 ChEBI InChI Value:   InChI=1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-7,15-17H ChEBI InChIKey Value:   YUTJCNNFTOIOGT-UHFFFAOYSA-N ChEBI Compound Name:   anthracene-1,8,9-triol ChEBI SMILES Value:   Oc1cccc2cc3cccc(O)c3c(O)c12 ChEBI Substance ID:   17487272 ChEBI URL:   ChEBI:2756 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   YUTJCNNFTOIOGT_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   10187