Select any link to see items in a related category.
more general categories information about this item 08. Chemical Category 08. Chemical Category main group molecular entity [CHEBI:33579] (25650) s-block molecular entity [CHEBI:33674] (7287) hydrogen molecular entity [CHEBI:33608] (6932) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) p-block molecular entity [CHEBI:33675] (25343) chalcogen molecular entity [CHEBI:33304] (15225) oxygen molecular entity [CHEBI:25806] (14414) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) carbon group molecular entity [CHEBI:33582] (23847) organic molecular entity [CHEBI:50860] (23769) lipid [CHEBI:18059] (3532) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) heteroorganic entity [CHEBI:33285] (15197) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) organic acid [CHEBI:64709] (3008) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) organic molecule [CHEBI:72695] (11399) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) polyatomic entity [CHEBI:36357] (18777) molecule [CHEBI:25367] (11520) organic molecule [CHEBI:72695] (11399) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) heteroatomic molecular entity [CHEBI:37577] (13672) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) unsaturated fatty acid [CHEBI:27208] (309) monounsaturated fatty acid [CHEBI:25413] (113) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) medium-chain fatty acid [CHEBI:59554] (82) heptenoic acid [CHEBI:36151] (5) 2-heptenoic acid [CHEBI:36152] (4) ChEBI Compound Accession Identifier: [CHEBI:36152] ChEBI Compound Description: A heptenoic acid with the double bond at position 2. ChEBI Compound Identification Number: 36152 ChEBI InChI Value: InChI=1S/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9) ChEBI InChIKey Value: YURNCBVQZBJDAJ-UHFFFAOYSA-N ChEBI Compound Name: 2-heptenoic acid ChEBI SMILES Value: [H]C(CCCC)=CC(O)=O ChEBI Substance ID: 24712313 ChEBI URL: ChEBI:36152 ChemSpider ID: 27308 Ontomatica Chemical Accession Key (OnChAKey): YURNCBVQZBJDAJ_UHFFFAOYSA_N_000_000000 PubChem Compound ID: 29373
