New Search

Item 2 of 2 (back to results)
Previous previous

hydroxyzine pamoate
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 ammonium compound [CHEBI:35276] (129) 
 organoammonium salt [CHEBI:46850] (104) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 piperazinium salt [CHEBI:46849] (2) 
 hydroxyzine pamoate [CHEBI:31680] (1)
ChEBI Compound Accession Identifier  [CHEBI:31680]
ChEBI Compound Description  null
ChEBI Compound Identification Number  31680
ChEBI InChI Value  "InChI=1S/C23H16O6.C21H27ClN2O2/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-10,24-25H,11H2,(H,26,27)(H,28,29);1-9,21,25H,10-17H2"
ChEBI InChIKey Value  ASDOKGIIKXGMNB-UHFFFAOYSA-N
ChEBI Compound Name  hydroxyzine pamoate
ChEBI SMILES Value  OCCOCC[NH+]1CC[NH+](CC1)C(c1ccccc1)c1ccc(Cl)cc1.Oc1c(cc2ccccc2c1Cc1c(O)c(cc2ccccc12)C([O-])=O)C([O-])=O
ChEBI Substance ID  50139260
ChEBI URL  ChEBI:31680
ChemSpider ID  23443
Ontomatica Chemical Accession Key (OnChAKey)  ASDOKGIIKXGMNB_UHFFFAOYSA_N_000_000000
PubChem Compound ID  54740721