New Search

Item 2 of 3 (back to results)
Previous previous next Next

streptothricin F
A streptothricin in which the peptide side-chain consists of a single unit of beta-lysine.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 antimicrobial agent [CHEBI:33281] (927) 
 antibiotic [CHEBI:22582] (193) 
 streptothricin F [CHEBI:60821] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 cyclic amide [CHEBI:3990] (252) 
 lactam [CHEBI:24995] (252) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 N-glycosyl compound [CHEBI:21731] (294) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 guanidines [CHEBI:24436] (80) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 carboxamide [CHEBI:37622] (1381) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 carbamate ester [CHEBI:23003] (103) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 carboxamide [CHEBI:37622] (1381) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 N-glycosyl compound [CHEBI:21731] (294) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 N-glycosyl compound [CHEBI:21731] (294) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 carbamate ester [CHEBI:23003] (103) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 carboxamide [CHEBI:37622] (1381) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 N-glycosyl compound [CHEBI:21731] (294) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 N-glycosyl compound [CHEBI:21731] (294) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 N-glycosyl compound [CHEBI:21731] (294) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 guanidines [CHEBI:24436] (80) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 carboxamide [CHEBI:37622] (1381) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 carbamate ester [CHEBI:23003] (103) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 carboxamide [CHEBI:37622] (1381) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 N-glycosyl compound [CHEBI:21731] (294) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 N-glycosyl compound [CHEBI:21731] (294) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 carbamate ester [CHEBI:23003] (103) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 carbamate ester [CHEBI:23003] (103) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 carbamate ester [CHEBI:23003] (103) 
 streptothricin [CHEBI:26789] (3) 
 streptothricin F [CHEBI:60821] (1)
ChEBI Compound Accession Identifier  [CHEBI:60821]
ChEBI Compound Description  A streptothricin in which the peptide side-chain consists of a single unit of beta-lysine.
ChEBI Compound Identification Number  60821
ChEBI InChI Value  InChI=1S/C19H34N8O8/c20-3-1-2-7(21)4-10(30)24-13-14(31)15(35-18(22)33)9(6-28)34-17(13)27-19-25-11-8(29)5-23-16(32)12(11)26-19/h7-9,11-15,17,28-29,31H,1-6,20-21H2,(H2,22,33)(H,23,32)(H,24,30)(H2,25,26,27)/t7-,8+,9+,11+,12-,13+,14-,15-,17+/m0/s1
ChEBI InChIKey Value  NRAUADCLPJTGSF-VLSXYIQESA-N
ChEBI Compound Name  streptothricin F
ChEBI SMILES Value  [H][C@]12N\\C(N[C@]1([H])C(=O)NC[C@H]2O)=N/[C@@H]1O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]1NC(=O)C[C@@H](N)CCCN
ChEBI Substance ID  104222417
ChEBI URL  ChEBI:60821
ChemSpider ID  0
Ontomatica Chemical Accession Key (OnChAKey)  NRAUADCLPJTGSF_VLSXYIQESA_N_000_000001
PubChem Compound ID  197034