New Search

Item 2 of 5 (back to results)
Previous previous next Next

FADH2
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 phosphorus molecular entity [CHEBI:26082] (2769) 
 organophosphorus compound [CHEBI:25710] (1528) 
 organic phosphate [CHEBI:25703] (1511) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 phosphorus oxoacids and derivatives [CHEBI:36360] (2691) 
 phosphorus oxoacid derivative [CHEBI:36359] (2628) 
 phosphoric acid derivative [CHEBI:26079] (2611) 
 organic phosphate [CHEBI:25703] (1511) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 phosphate [CHEBI:26020] (1522) 
 organic phosphate [CHEBI:25703] (1511) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 phosphoric ester [CHEBI:37734] (1466) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organophosphorus compound [CHEBI:25710] (1528) 
 organic phosphate [CHEBI:25703] (1511) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 ester [CHEBI:35701] (3370) 
 phosphoric ester [CHEBI:37734] (1466) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 oxoacid derivative [CHEBI:33241] (3254) 
 phosphorus oxoacid derivative [CHEBI:36359] (2628) 
 phosphoric acid derivative [CHEBI:26079] (2611) 
 organic phosphate [CHEBI:25703] (1511) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 phosphate [CHEBI:26020] (1522) 
 organic phosphate [CHEBI:25703] (1511) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 phosphoric ester [CHEBI:37734] (1466) 
 nucleoside phosphate [CHEBI:25608] (412) 
 nucleotide [CHEBI:36976] (398) 
 flavin nucleotide [CHEBI:36981] (8) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
 dinucleotide [CHEBI:47885] (33) 
 flavin adenine dinucleotide [CHEBI:24040] (5) 
 FADH2 [CHEBI:17877] (1)
ChEBI Compound Accession Identifier  [CHEBI:17877]
ChEBI Compound Description  null
ChEBI Compound Identification Number  17877
ChEBI InChI Value  InChI=1S/C27H35N9O15P2/c1-10-3-12-13(4-11(10)2)35(24-18(32-12)25(42)34-27(43)33-24)5-14(37)19(39)15(38)6-48-52(44,45)51-53(46,47)49-7-16-20(40)21(41)26(50-16)36-9-31-17-22(28)29-8-30-23(17)36/h3-4,8-9,14-16,19-21,26,32,37-41H,5-7H2,1-2H3,(H,44,45)(H,46,47)(H2,28,29,30)(H2,33,34,42,43)/t14-,15+,16+,19-,20+,21+,26+/m0/s1
ChEBI InChIKey Value  YPZRHBJKEMOYQH-UYBVJOGSSA-N
ChEBI Compound Name  FADH2
ChEBI SMILES Value  Cc1cc2Nc3c([nH]c(=O)[nH]c3=O)N(C[C@H](O)[C@H](O)[C@H](O)COP(O)(=O)OP(O)(=O)OC[C@H]3O[C@H]([C@H](O)[C@@H]3O)n3cnc4c(N)ncnc34)c2cc1C
ChEBI Substance ID  8143970
ChEBI URL  ChEBI:17877
ChemSpider ID  393487
Ontomatica Chemical Accession Key (OnChAKey)  YPZRHBJKEMOYQH_UYBVJOGSSA_N_000_000000
PubChem Compound ID  446013