Select any link to see items in a related category.

more general categories	information about this item
04. Bioactive Capabilities of Specific Chemicals	04. Bioactive Capabilities of Specific Chemicals
Hydrolases [EC:3] (824)
Acting on carbon-nitrogen bonds, other than peptide bonds [EC:3.5] (303)
In linear amides [EC:3.5.1] (174)
Biotinidase [EC:3.5.1.12] (4)	biotin amide [CHEBI:16615] (1)
08. Chemical Category	08. Chemical Category
main group molecular entity [CHEBI:33579] (25650)
s-block molecular entity [CHEBI:33674] (7287)
hydrogen molecular entity [CHEBI:33608] (6932)
hydroxides [CHEBI:24651] (5641)
oxoacid [CHEBI:24833] (3119)
carbon oxoacid [CHEBI:35605] (3012)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
p-block molecular entity [CHEBI:33675] (25343)
pnictogen molecular entity [CHEBI:33302] (10027)
nitrogen molecular entity [CHEBI:51143] (7930)
amide [CHEBI:32988] (1863)
primary amide [CHEBI:33256] (1586)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	biotin amide [CHEBI:16615] (1)
ureas [CHEBI:47857] (101)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organonitrogen compound [CHEBI:35352] (6705)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	biotin amide [CHEBI:16615] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
chalcogen molecular entity [CHEBI:33304] (15225)
oxygen molecular entity [CHEBI:25806] (14414)
hydroxides [CHEBI:24651] (5641)
oxoacid [CHEBI:24833] (3119)
carbon oxoacid [CHEBI:35605] (3012)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organooxygen compound [CHEBI:36963] (11352)
carbon oxoacid [CHEBI:35605] (3012)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
carbonyl compound [CHEBI:36586] (5928)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	biotin amide [CHEBI:16615] (1)
sulfur molecular entity [CHEBI:26835] (1541)
organosulfur compound [CHEBI:33261] (1005)
organosulfur heterocyclic compound [CHEBI:38106] (367)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organochalcogen compound [CHEBI:36962] (11874)
organosulfur compound [CHEBI:33261] (1005)
organosulfur heterocyclic compound [CHEBI:38106] (367)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organooxygen compound [CHEBI:36963] (11352)
carbon oxoacid [CHEBI:35605] (3012)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
carbonyl compound [CHEBI:36586] (5928)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	biotin amide [CHEBI:16615] (1)
carbon group molecular entity [CHEBI:33582] (23847)
organic molecular entity [CHEBI:50860] (23769)
heteroorganic entity [CHEBI:33285] (15197)
organic heterocyclic compound [CHEBI:24532] (5243)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterobicyclic compound [CHEBI:27171] (1315)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organonitrogen compound [CHEBI:35352] (6705)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	biotin amide [CHEBI:16615] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organochalcogen compound [CHEBI:36962] (11874)
organosulfur compound [CHEBI:33261] (1005)
organosulfur heterocyclic compound [CHEBI:38106] (367)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organooxygen compound [CHEBI:36963] (11352)
carbon oxoacid [CHEBI:35605] (3012)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
carbonyl compound [CHEBI:36586] (5928)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	biotin amide [CHEBI:16615] (1)
organic acid [CHEBI:64709] (3008)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterobicyclic compound [CHEBI:27171] (1315)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic oxo compound [CHEBI:36587] (5932)
carbonyl compound [CHEBI:36586] (5928)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
polyatomic entity [CHEBI:36357] (18777)
molecule [CHEBI:25367] (11520)
cyclic compound [CHEBI:33595] (7817)
polycyclic compound [CHEBI:33635] (4078)
heteropolycyclic compound [CHEBI:33671] (2613)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterobicyclic compound [CHEBI:27171] (1315)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
bicyclic compound [CHEBI:33636] (1511)
heterobicyclic compound [CHEBI:33672] (1315)
organic heterobicyclic compound [CHEBI:27171] (1315)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterobicyclic compound [CHEBI:27171] (1315)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
heterocyclic compound [CHEBI:5686] (5275)
organic heterocyclic compound [CHEBI:24532] (5243)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterobicyclic compound [CHEBI:27171] (1315)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
heteropolycyclic compound [CHEBI:33671] (2613)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterobicyclic compound [CHEBI:27171] (1315)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
heterobicyclic compound [CHEBI:33672] (1315)
organic heterobicyclic compound [CHEBI:27171] (1315)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organosulfur heterocyclic compound [CHEBI:38106] (367)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic heteropolycyclic compound [CHEBI:38166] (2613)
organic heterobicyclic compound [CHEBI:27171] (1315)
azabicycloalkane [CHEBI:38295] (38)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
thiabicycloalkane [CHEBI:38297] (11)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
organic oxo compound [CHEBI:36587] (5932)
carbonyl compound [CHEBI:36586] (5928)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
heteroatomic molecular entity [CHEBI:37577] (13672)
hydroxides [CHEBI:24651] (5641)
oxoacid [CHEBI:24833] (3119)
carbon oxoacid [CHEBI:35605] (3012)
carboxylic acid [CHEBI:33575] (3005)
monocarboxylic acid [CHEBI:25384] (1620)
biotins [CHEBI:51570] (4)	biotin amide [CHEBI:16615] (1)
ChEBI Compound Accession Identifier:	[CHEBI:16615]
ChEBI Compound Description:	null
ChEBI Compound Identification Number:	16615
ChEBI InChI Value:	InChI=1S/C10H17N3O2S/c11-8(14)4-2-1-3-7-9-6(5-16-7)12-10(15)13-9/h6-7,9H,1-5H2,(H2,11,14)(H2,12,13,15)/t6-,7-,9-/m0/s1
ChEBI InChIKey Value:	XFLVBMBRLSCJAI-ZKWXMUAHSA-N
ChEBI Compound Name:	biotin amide
ChEBI SMILES Value:	[H][C@]12CS[C@@H](CCCCC(N)=O)[C@@]1([H])NC(=O)N2
ChEBI Substance ID:	8143481
ChEBI URL:	ChEBI:16615
ChemSpider ID:	75650
Ontomatica Chemical Accession Key (OnChAKey):	XFLVBMBRLSCJAI_ZKWXMUAHSA_N_000_000000
PubChem Compound ID:	83831